Difference between revisions of "Tiso gene 412"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XYLULOSE-5-PHOSPHATE XYLULOSE-5-PHOSPHATE] == * smiles: ** C(OP([O-])(=O)[O-])C(O)C(O)C(=O)CO *...") |
(Created page with "Category:Gene == Gene Tiso_gene_412 == * Synonym(s): == Reactions associated == * Reaction: RXN-1224 ** Source: orthology-esiliculosus * Reaction: RXN-15117 *...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_412 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | + | * Reaction: [[RXN-1224]] | |
| − | * [[ | + | ** Source: [[orthology-esiliculosus]] |
| − | + | * Reaction: [[RXN-15117]] | |
| − | + | ** Source: [[orthology-athaliana]] | |
| − | * [[ | + | == Pathways associated == |
| − | * [[ | + | * [[PWY-7817]] |
| − | * [[ | + | * [[PWYQT-4427]] |
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=RXN-1224|RXN-15117}} | |
| − | + | {{#set: pathway associated=PWY-7817|PWYQT-4427}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 19:55, 21 March 2018
Gene Tiso_gene_412
- Synonym(s):
Reactions associated
- Reaction: RXN-1224
- Source: orthology-esiliculosus
- Reaction: RXN-15117
- Source: orthology-athaliana
