Difference between revisions of "CPD-11518"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_15687 == * left end position: ** 1916 * transcription direction: ** POSITIVE * right end position: ** 4355 * centisome position: ** 39.3025...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11518 CPD-11518] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)CO...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11518 CPD-11518] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCC=CCC4(C(=O)CCC(CCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4) |
| − | * | + | * common name: |
| − | ** | + | ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octa-2-enoyl-CoA |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=WDBPMRZYBZCIQE-WCBSGRPJSA-J |
| − | * | + | * molecular weight: |
| − | ** | + | ** 1037.905 |
* Synonym(s): | * Synonym(s): | ||
| + | ** OPC8-trans-2-enoyl-CoA | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-10697]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-10696]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237209 44237209] |
| − | {{#set: | + | {{#set: smiles=CCC=CCC4(C(=O)CCC(CCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}} |
| − | {{#set: | + | {{#set: common name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octa-2-enoyl-CoA}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=WDBPMRZYBZCIQE-WCBSGRPJSA-J}} |
| − | {{#set: | + | {{#set: molecular weight=1037.905 }} |
| + | {{#set: common name=OPC8-trans-2-enoyl-CoA}} | ||
| + | {{#set: consumed by=RXN-10697}} | ||
| + | {{#set: produced by=RXN-10696}} | ||
Latest revision as of 19:55, 21 March 2018
Contents
Metabolite CPD-11518
- smiles:
- CCC=CCC4(C(=O)CCC(CCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
- common name:
- 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octa-2-enoyl-CoA
- inchi key:
- InChIKey=WDBPMRZYBZCIQE-WCBSGRPJSA-J
- molecular weight:
- 1037.905
- Synonym(s):
- OPC8-trans-2-enoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCC=CCC4(C(=O)CCC(CCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)" cannot be used as a page name in this wiki.
