Difference between revisions of "N-ACETYL-D-GLUCOSAMINE-1-P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14388 RXN-14388] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-GLUCOSAMINE-1-P N-ACETYL-D-GLUCOSAMINE-1-P] == * smiles: ** CC(=O)NC1(C(O)C(O)C(CO)O...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14388 RXN-14388] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-GLUCOSAMINE-1-P N-ACETYL-D-GLUCOSAMINE-1-P] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(=O)NC1(C(O)C(O)C(CO)OC(OP(=O)([O-])[O-])1)
 +
* common name:
 +
** N-acetyl-α-D-glucosamine 1-phosphate
 +
* inchi key:
 +
** InChIKey=FZLJPEPAYPUMMR-FMDGEEDCSA-L
 +
* molecular weight:
 +
** 299.174   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[NAG1P-URIDYLTRANS-RXN]]
−
** 1 [[CD-SP-2Fe2S-Complex]][c] '''+''' 1 [[FeS-Cluster-Co-Chaperones]][c] '''=>''' 1 [[L-Cysteine-Desulfurases]][c] '''+''' 1 [[Co-chaperone-SP-2Fe2S-Complex]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-16426]]
−
** 1 a [cysteine desulfurase]-[scaffold protein-(2Fe-2S)] complex[c] '''+''' 1 an [Fe-S cluster biosynthesis co-chaperone][c] '''=>''' 1 an [L-cysteine desulfurase][c] '''+''' 1 a [co-chaperone]-[scaffold protein-(2Fe-2S)] complex[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
* [[PHOSACETYLGLUCOSAMINEMUT-RXN]]
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-7250]], [2Fe-2S] iron-sulfur cluster biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7250 PWY-7250]
+
−
** '''10''' reactions found over '''10''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* LIGAND-CPD:
−
{{#set: in pathway=PWY-7250}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C04256 C04256]
−
{{#set: reconstruction category=annotation}}
+
* HMDB : HMDB01367
−
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
+
* CHEBI:
−
{{#set: reconstruction tool=pathwaytools}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57776 57776]
 +
* BIGG : acgam1p
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243937 25243937]
 +
{{#set: smiles=CC(=O)NC1(C(O)C(O)C(CO)OC(OP(=O)([O-])[O-])1)}}
 +
{{#set: common name=N-acetyl-α-D-glucosamine 1-phosphate}}
 +
{{#set: inchi key=InChIKey=FZLJPEPAYPUMMR-FMDGEEDCSA-L}}
 +
{{#set: molecular weight=299.174    }}
 +
{{#set: consumed by=NAG1P-URIDYLTRANS-RXN}}
 +
{{#set: produced by=RXN-16426}}
 +
{{#set: reversible reaction associated=PHOSACETYLGLUCOSAMINEMUT-RXN}}

Latest revision as of 19:56, 21 March 2018

Metabolite N-ACETYL-D-GLUCOSAMINE-1-P

  • smiles:
    • CC(=O)NC1(C(O)C(O)C(CO)OC(OP(=O)([O-])[O-])1)
  • common name:
    • N-acetyl-α-D-glucosamine 1-phosphate
  • inchi key:
    • InChIKey=FZLJPEPAYPUMMR-FMDGEEDCSA-L
  • molecular weight:
    • 299.174
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=O)NC1(C(O)C(O)C(CO)OC(OP(=O)([O-])[O-])1)" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=N-ACETYL-D-GLUCOSAMINE-1-P&oldid=44721"