Difference between revisions of "Tiso gene 5609"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-GLUCOSAMINE-1-P N-ACETYL-D-GLUCOSAMINE-1-P] == * smiles: ** CC(=O)NC1(C(O)C(O)C(CO)O...")
(Created page with "Category:Gene == Gene Tiso_gene_5609 == * right end position: ** 8593 * transcription direction: ** NEGATIVE * left end position: ** 6074 * centisome position: ** 46.18660...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-GLUCOSAMINE-1-P N-ACETYL-D-GLUCOSAMINE-1-P] ==
+
== Gene Tiso_gene_5609 ==
* smiles:
+
* right end position:
** CC(=O)NC1(C(O)C(O)C(CO)OC(OP(=O)([O-])[O-])1)
+
** 8593
* inchi key:
+
* transcription direction:
** InChIKey=FZLJPEPAYPUMMR-FMDGEEDCSA-L
+
** NEGATIVE
* common name:
+
* left end position:
** N-acetyl-α-D-glucosamine 1-phosphate
+
** 6074
* molecular weight:
+
* centisome position:
** 299.174    
+
** 46.186604    
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[NAG1P-URIDYLTRANS-RXN]]
+
* Reaction: [[IDS1]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-creinhardtii]]
* [[RXN-16426]]
+
* Reaction: [[IDS2]]
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-creinhardtii]]
* [[PHOSACETYLGLUCOSAMINEMUT-RXN]]
+
* Reaction: [[ISPH2-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[R07219]]
 +
** Source: [[orthology-synechocystis]]
 +
* Reaction: [[RXN0-884]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[NONMEVIPP-PWY]]
 +
* [[PWY-7560]]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: right end position=8593}}
** [http://www.genome.jp/dbget-bin/www_bget?C04256 C04256]
+
{{#set: transcription direction=NEGATIVE}}
* CHEBI:
+
{{#set: left end position=6074}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57776 57776]
+
{{#set: centisome position=46.186604   }}
* BIGG : acgam1p
+
{{#set: reaction associated=IDS1|IDS2|ISPH2-RXN|R07219|RXN0-884}}
* PUBCHEM:
+
{{#set: pathway associated=NONMEVIPP-PWY|PWY-7560}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243937 25243937]
+
* HMDB : HMDB01367
+
{{#set: smiles=CC(=O)NC1(C(O)C(O)C(CO)OC(OP(=O)([O-])[O-])1)}}
+
{{#set: inchi key=InChIKey=FZLJPEPAYPUMMR-FMDGEEDCSA-L}}
+
{{#set: common name=N-acetyl-α-D-glucosamine 1-phosphate}}
+
{{#set: molecular weight=299.174   }}
+
{{#set: consumed by=NAG1P-URIDYLTRANS-RXN}}
+
{{#set: produced by=RXN-16426}}
+
{{#set: reversible reaction associated=PHOSACETYLGLUCOSAMINEMUT-RXN}}
+

Latest revision as of 19:56, 21 March 2018

Gene Tiso_gene_5609

  • right end position:
    • 8593
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 6074
  • centisome position:
    • 46.186604
  • Synonym(s):

Reactions associated

Pathways associated

External links