Difference between revisions of "CPD-15318"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Pectin Pectin] == * common name: ** a pectin * Synonym(s): ** pectin == Reaction(s) known to c...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15318 CPD-15318] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) * common name: ** &a...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Pectin Pectin] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15318 CPD-15318] ==
 +
* smiles:
 +
** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)
 
* common name:
 
* common name:
** a pectin
+
** α-D-ribose 5-phosphate
 +
* inchi key:
 +
** InChIKey=KTVPXOYAKDPRHY-AIHAYLRMSA-L
 +
* molecular weight:
 +
** 228.095   
 
* Synonym(s):
 
* Synonym(s):
** pectin
+
** α-D-ribofuranose 5-phosphate
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[R5PDP]]
 +
* [[RXN-14997]]
 +
* [[RXN-15345]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ARDP]]
 +
* [[RIBOKIN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[4.2.2.10-RXN]]
+
* [[RPDPK]]
 +
* [[RXN-14456]]
 
== External links  ==
 
== External links  ==
{{#set: common name=a pectin}}
+
* PUBCHEM:
{{#set: common name=pectin}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7098640 7098640]
{{#set: reversible reaction associated=4.2.2.10-RXN}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18189 18189]
 +
* METABOLIGHTS : MTBLC18189
 +
{{#set: smiles=C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)}}
 +
{{#set: common name=α-D-ribose 5-phosphate}}
 +
{{#set: inchi key=InChIKey=KTVPXOYAKDPRHY-AIHAYLRMSA-L}}
 +
{{#set: molecular weight=228.095    }}
 +
{{#set: common name=α-D-ribofuranose 5-phosphate}}
 +
{{#set: consumed by=R5PDP|RXN-14997|RXN-15345}}
 +
{{#set: produced by=ARDP|RIBOKIN-RXN}}
 +
{{#set: reversible reaction associated=RPDPK|RXN-14456}}

Latest revision as of 19:56, 21 March 2018

Metabolite CPD-15318

  • smiles:
    • C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)
  • common name:
    • α-D-ribose 5-phosphate
  • inchi key:
    • InChIKey=KTVPXOYAKDPRHY-AIHAYLRMSA-L
  • molecular weight:
    • 228.095
  • Synonym(s):
    • α-D-ribofuranose 5-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)" cannot be used as a page name in this wiki.