Difference between revisions of "CPD-15318"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Pectin Pectin] == * common name: ** a pectin * Synonym(s): ** pectin == Reaction(s) known to c...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15318 CPD-15318] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) * common name: ** &a...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15318 CPD-15318] == |
+ | * smiles: | ||
+ | ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) | ||
* common name: | * common name: | ||
− | ** | + | ** α-D-ribose 5-phosphate |
+ | * inchi key: | ||
+ | ** InChIKey=KTVPXOYAKDPRHY-AIHAYLRMSA-L | ||
+ | * molecular weight: | ||
+ | ** 228.095 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** α-D-ribofuranose 5-phosphate |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[R5PDP]] | ||
+ | * [[RXN-14997]] | ||
+ | * [[RXN-15345]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[ARDP]] | ||
+ | * [[RIBOKIN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[RPDPK]] |
+ | * [[RXN-14456]] | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7098640 7098640] |
− | {{#set: reversible reaction associated= | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18189 18189] | ||
+ | * METABOLIGHTS : MTBLC18189 | ||
+ | {{#set: smiles=C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)}} | ||
+ | {{#set: common name=α-D-ribose 5-phosphate}} | ||
+ | {{#set: inchi key=InChIKey=KTVPXOYAKDPRHY-AIHAYLRMSA-L}} | ||
+ | {{#set: molecular weight=228.095 }} | ||
+ | {{#set: common name=α-D-ribofuranose 5-phosphate}} | ||
+ | {{#set: consumed by=R5PDP|RXN-14997|RXN-15345}} | ||
+ | {{#set: produced by=ARDP|RIBOKIN-RXN}} | ||
+ | {{#set: reversible reaction associated=RPDPK|RXN-14456}} |
Latest revision as of 19:56, 21 March 2018
Contents
Metabolite CPD-15318
- smiles:
- C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)
- common name:
- α-D-ribose 5-phosphate
- inchi key:
- InChIKey=KTVPXOYAKDPRHY-AIHAYLRMSA-L
- molecular weight:
- 228.095
- Synonym(s):
- α-D-ribofuranose 5-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)" cannot be used as a page name in this wiki.