Difference between revisions of "RXN66-469"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ALLO-THREONINE L-ALLO-THREONINE] == * smiles: ** CC(O)C([N+])C(=O)[O-] * inchi key: ** InChIK...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-469 RXN66-469] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-methyl-branched fatty acy...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ALLO-THREONINE L-ALLO-THREONINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-469 RXN66-469] ==
−
* smiles:
+
* direction:
−
** CC(O)C([N+])C(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=AYFVYJQAPQTCCC-HRFVKAFMSA-N
+
 
* common name:
 
* common name:
−
** L-allo-threonine
+
** 3-methyl-branched fatty acyl-CoA ligase
−
* molecular weight:
+
** polyketide_synthase
−
** 119.12   
+
** long_chain_acyl-_synthetase
 +
** acyl-_synthetase
 +
** ORF
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/6.2.1.3 EC-6.2.1.3]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-16001]]
+
* With identifiers:
−
* [[RXN-16000]]
+
** 1 [[ATP]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[3-Methyl-Saturated-Fatty-Acids]][c] '''=>''' 1 [[3-Methyl-Saturated-Fatty-Acyl-CoA]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[AMP]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 ATP[c] '''+''' 1 coenzyme A[c] '''+''' 1 a 3-methyl-branched 2,3,4-saturated fatty acid[c] '''=>''' 1 a 3-methyl-branched 2,3,4-saturated fatty acyl-CoA[c] '''+''' 1 diphosphate[c] '''+''' 1 AMP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_10876]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_7855]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_4191]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_9394]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_348]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_500]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_135]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_13394]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_136]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY66-387]], fatty acid α-oxidation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-387 PWY66-387]
 +
** '''4''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* NCI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=206283 206283]
+
{{#set: common name=3-methyl-branched fatty acyl-CoA ligase}}
−
* CAS : 28954-12-3
+
{{#set: common name=polyketide_synthase}}
−
* METABOLIGHTS : MTBLC58585
+
{{#set: common name=long_chain_acyl-_synthetase}}
−
* PUBCHEM:
+
{{#set: common name=acyl-_synthetase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6995276 6995276]
+
{{#set: common name=ORF}}
−
* HMDB : HMDB04041
+
{{#set: ec number=EC-6.2.1.3}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Tiso_gene_10876|Tiso_gene_7855|Tiso_gene_4191|Tiso_gene_9394|Tiso_gene_348|Tiso_gene_500|Tiso_gene_135|Tiso_gene_13394|Tiso_gene_136}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05519 C05519]
+
{{#set: in pathway=PWY66-387}}
−
* CHEBI:
+
{{#set: reconstruction category=orthology|annotation}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58585 58585]
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}}
−
* BIGG : athr__L
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: smiles=CC(O)C([N+])C(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=AYFVYJQAPQTCCC-HRFVKAFMSA-N}}
+
−
{{#set: common name=L-allo-threonine}}
+
−
{{#set: molecular weight=119.12    }}
+
−
{{#set: consumed by=RXN-16001|RXN-16000}}
+

Latest revision as of 19:56, 21 March 2018

Reaction RXN66-469

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-methyl-branched fatty acyl-CoA ligase
    • polyketide_synthase
    • long_chain_acyl-_synthetase
    • acyl-_synthetase
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY66-387, fatty acid α-oxidation II: PWY66-387
    • 4 reactions found over 6 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN66-469&oldid=44808"