Difference between revisions of "Protein-Histidines"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4211 CPD-4211] == * smiles: ** CC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-] * inchi key: ** InChIKe...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-Histidines Protein-Histidines] == * common name: ** a [protein]-L-histidine * Synonym(s...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-Histidines Protein-Histidines] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a [protein]-L-histidine |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** a peptidyl L-histidine |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.7.13.3-RXN]] |
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[RXN-15512]] |
| − | * [[ | + | * [[RXN-15509]] |
| + | * [[RXN-15510]] | ||
| + | * [[RXN-15511]] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a [protein]-L-histidine}} | |
| − | + | {{#set: common name=a peptidyl L-histidine}} | |
| − | + | {{#set: consumed by=2.7.13.3-RXN}} | |
| − | + | {{#set: reversible reaction associated=RXN-15512|RXN-15509|RXN-15510|RXN-15511}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: consumed by= | + | |
| − | + | ||
| − | {{#set: reversible reaction associated= | + | |
Latest revision as of 19:57, 21 March 2018
Contents
Metabolite Protein-Histidines
- common name:
- a [protein]-L-histidine
- Synonym(s):
- a peptidyl L-histidine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a [protein]-L-histidine" cannot be used as a page name in this wiki.
