Difference between revisions of "GALACTOSE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-phenylalanyl-L-arginyl-Protein L-phenylalanyl-L-arginyl-Protein] == * common name: ** L-pheny...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE GALACTOSE] == * smiles: ** C(O)C1(OC(O)C(O)C(O)C(O)1) * common name: ** β-D-gala...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE GALACTOSE] == |
| + | * smiles: | ||
| + | ** C(O)C1(OC(O)C(O)C(O)C(O)1) | ||
* common name: | * common name: | ||
| − | ** | + | ** β-D-galactose |
| + | * inchi key: | ||
| + | ** InChIKey=WQZGKKKJIJFFOK-FPRJBGLDSA-N | ||
| + | * molecular weight: | ||
| + | ** 180.157 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** β-D-galactopyranose | ||
| + | ** cerebrose | ||
| + | ** 6-(hydroxymethyl)tetrahydropyran-2,3,4,5-tetraol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[BETAGALACTOSID-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[ALDOSE1EPIM-RXN]] | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * CAS : 7296-64-2 |
| − | {{#set: produced by=RXN- | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439353 439353] | ||
| + | * HMDB : HMDB03449 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00962 C00962] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.388476.html 388476] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28034 28034] | ||
| + | * BIGG : gal | ||
| + | * BIGG : gal-bD | ||
| + | {{#set: smiles=C(O)C1(OC(O)C(O)C(O)C(O)1)}} | ||
| + | {{#set: common name=β-D-galactose}} | ||
| + | {{#set: inchi key=InChIKey=WQZGKKKJIJFFOK-FPRJBGLDSA-N}} | ||
| + | {{#set: molecular weight=180.157 }} | ||
| + | {{#set: common name=β-D-galactopyranose|cerebrose|6-(hydroxymethyl)tetrahydropyran-2,3,4,5-tetraol}} | ||
| + | {{#set: produced by=BETAGALACTOSID-RXN}} | ||
| + | {{#set: reversible reaction associated=ALDOSE1EPIM-RXN}} | ||
Latest revision as of 19:57, 21 March 2018
Contents
Metabolite GALACTOSE
- smiles:
- C(O)C1(OC(O)C(O)C(O)C(O)1)
- common name:
- β-D-galactose
- inchi key:
- InChIKey=WQZGKKKJIJFFOK-FPRJBGLDSA-N
- molecular weight:
- 180.157
- Synonym(s):
- β-D-galactopyranose
- cerebrose
- 6-(hydroxymethyl)tetrahydropyran-2,3,4,5-tetraol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 7296-64-2
- PUBCHEM:
- HMDB : HMDB03449
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : gal
- BIGG : gal-bD
