Difference between revisions of "RXN-14771"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10806 CPD-10806] == * smiles: ** CCCCCC(O)[CH]=CC=O * inchi key: ** InChIKey=JVJFIQYAHPMBBX...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14771 RXN-14771] == * direction: ** LEFT-TO-RIGHT * common name: ** acyl-coenzyme_a_oxidase * e...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10806 CPD-10806] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14771 RXN-14771] ==
* smiles:
+
* direction:
** CCCCCC(O)[CH]=CC=O
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=JVJFIQYAHPMBBX-FNORWQNLSA-N
+
 
* common name:
 
* common name:
** 4-hydroxy-2-nonenal
+
** acyl-coenzyme_a_oxidase
* molecular weight:
+
* ec number:
** 156.224   
+
** [http://enzyme.expasy.org/EC/1.3.3.6 EC-1.3.3.6]
 
* Synonym(s):
 
* Synonym(s):
** 4HNE
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-13673]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-15637]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[CPD-15666]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 6-cis-tridecenoyl-CoA[c] '''+''' 1 oxygen[c] '''=>''' 1 hydrogen peroxide[c] '''+''' 1 6-cis, 2-trans-tridecadienoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_18566]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-7337]], 10-cis-heptadecenoyl-CoA degradation (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7337 PWY-7337]
 +
** '''3''' reactions found over '''12''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5283344 5283344]
+
{{#set: common name=acyl-coenzyme_a_oxidase}}
* CHEMSPIDER:
+
{{#set: ec number=EC-1.3.3.6}}
** [http://www.chemspider.com/Chemical-Structure.4446465.html 4446465]
+
{{#set: gene associated=Tiso_gene_18566}}
* CHEBI:
+
{{#set: in pathway=PWY-7337}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32585 32585]
+
{{#set: reconstruction category=orthology|annotation}}
* METABOLIGHTS : MTBLC32585
+
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
* HMDB : HMDB04362
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
{{#set: smiles=CCCCCC(O)[CH]=CC=O}}
+
{{#set: inchi key=InChIKey=JVJFIQYAHPMBBX-FNORWQNLSA-N}}
+
{{#set: common name=4-hydroxy-2-nonenal}}
+
{{#set: molecular weight=156.224    }}
+
{{#set: common name=4HNE}}
+
{{#set: consumed by=RXN-13673}}
+

Latest revision as of 19:57, 21 March 2018

Reaction RXN-14771

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • acyl-coenzyme_a_oxidase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7337, 10-cis-heptadecenoyl-CoA degradation (yeast): PWY-7337
    • 3 reactions found over 12 reactions in the full pathway

Reconstruction information

External links