Difference between revisions of "Tiso gene 14710"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9699 CPD-9699] == * smiles: ** C=C1(C(CC([N+])C([O-])=O)C1) * inchi key: ** InChIKey=OOJZCX...") |
(Created page with "Category:Gene == Gene Tiso_gene_14710 == * right end position: ** 1566 * transcription direction: ** POSITIVE * left end position: ** 25 * centisome position: ** 0.456621...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_14710 == |
− | * | + | * right end position: |
− | ** | + | ** 1566 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 25 |
− | * | + | * centisome position: |
− | ** | + | ** 0.456621 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[RXN-12587]] |
− | + | ** Source: [[annotation-experimental_annotation]] | |
− | == | + | *** Assignment: ec-number |
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-12588]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-14382]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-14384]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-14385]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-14386]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-15881]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-9787]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN0-308]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY0-1021]] | ||
+ | * [[PWY-6823]] | ||
+ | * [[PWY-7250]] | ||
+ | * [[PWY-6892]] | ||
+ | * [[PWY-6891]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=1566}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=25}} | |
− | + | {{#set: centisome position=0.456621 }} | |
− | + | {{#set: reaction associated=RXN-12587|RXN-12588|RXN-14382|RXN-14384|RXN-14385|RXN-14386|RXN-15881|RXN-9787|RXN0-308}} | |
− | + | {{#set: pathway associated=PWY0-1021|PWY-6823|PWY-7250|PWY-6892|PWY-6891}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:57, 21 March 2018
Gene Tiso_gene_14710
- right end position:
- 1566
- transcription direction:
- POSITIVE
- left end position:
- 25
- centisome position:
- 0.456621
- Synonym(s):
Reactions associated
- Reaction: RXN-12587
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-experimental_annotation
- Reaction: RXN-12588
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-experimental_annotation
- Reaction: RXN-14382
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-experimental_annotation
- Reaction: RXN-14384
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-experimental_annotation
- Reaction: RXN-14385
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-experimental_annotation
- Reaction: RXN-14386
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-experimental_annotation
- Reaction: RXN-15881
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-experimental_annotation
- Reaction: RXN-9787
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-experimental_annotation
- Reaction: RXN0-308
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-experimental_annotation