Difference between revisions of "Tiso gene 14710"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9699 CPD-9699] == * smiles: ** C=C1(C(CC([N+])C([O-])=O)C1) * inchi key: ** InChIKey=OOJZCX...")
(Created page with "Category:Gene == Gene Tiso_gene_14710 == * right end position: ** 1566 * transcription direction: ** POSITIVE * left end position: ** 25 * centisome position: ** 0.456621...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9699 CPD-9699] ==
+
== Gene Tiso_gene_14710 ==
−
* smiles:
+
* right end position:
−
** C=C1(C(CC([N+])C([O-])=O)C1)
+
** 1566
−
* inchi key:
+
* transcription direction:
−
** InChIKey=OOJZCXFXPZGUBJ-UHFFFAOYSA-N
+
** POSITIVE
−
* common name:
+
* left end position:
−
** hypoglycin A
+
** 25
−
* molecular weight:
+
* centisome position:
−
** 141.169    
+
** 0.456621    
 
* Synonym(s):
 
* Synonym(s):
−
** hypoglycine
 
−
** hypoglycine A
 
−
** hypoglycin
 
−
** L-β-(methylenecyclopropyl)-alanine
 
−
** 2-amino-3-(2-methylidenecyclopropyl)propanoic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-9157]]
+
* Reaction: [[RXN-12587]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-experimental_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-12588]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-14382]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-14384]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-14385]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-14386]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-15881]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-9787]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN0-308]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY0-1021]]
 +
* [[PWY-6823]]
 +
* [[PWY-7250]]
 +
* [[PWY-6892]]
 +
* [[PWY-6891]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=1566}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244430 25244430]
+
{{#set: transcription direction=POSITIVE}}
−
* Wikipedia : Hypoglycin
+
{{#set: left end position=25}}
−
* LIGAND-CPD:
+
{{#set: centisome position=0.456621   }}
−
** [http://www.genome.jp/dbget-bin/www_bget?C08287 C08287]
+
{{#set: reaction associated=RXN-12587|RXN-12588|RXN-14382|RXN-14384|RXN-14385|RXN-14386|RXN-15881|RXN-9787|RXN0-308}}
−
* HMDB : HMDB29427
+
{{#set: pathway associated=PWY0-1021|PWY-6823|PWY-7250|PWY-6892|PWY-6891}}
−
{{#set: smiles=C=C1(C(CC([N+])C([O-])=O)C1)}}
+
−
{{#set: inchi key=InChIKey=OOJZCXFXPZGUBJ-UHFFFAOYSA-N}}
+
−
{{#set: common name=hypoglycin A}}
+
−
{{#set: molecular weight=141.169   }}
+
−
{{#set: common name=hypoglycine|hypoglycine A|hypoglycin|L-β-(methylenecyclopropyl)-alanine|2-amino-3-(2-methylidenecyclopropyl)propanoic acid}}
+
−
{{#set: consumed by=RXN-9157}}
+

Latest revision as of 19:57, 21 March 2018

Gene Tiso_gene_14710

  • right end position:
    • 1566
  • transcription direction:
    • POSITIVE
  • left end position:
    • 25
  • centisome position:
    • 0.456621
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_14710&oldid=44906"