Difference between revisions of "OH-PYR"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_8950 == * left end position: ** 126 * transcription direction: ** POSITIVE * right end position: ** 941 * centisome position: ** 1.2932363...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OH-PYR OH-PYR] == * smiles: ** C(C(=O)C([O-])=O)O * common name: ** hydroxypyruvate * inchi key...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OH-PYR OH-PYR] == |
− | * | + | * smiles: |
− | ** | + | ** C(C(=O)C([O-])=O)O |
− | * | + | * common name: |
− | ** | + | ** hydroxypyruvate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=HHDDCCUIIUWNGJ-UHFFFAOYSA-M |
− | * | + | * molecular weight: |
− | ** | + | ** 103.054 |
* Synonym(s): | * Synonym(s): | ||
+ | ** β-hydroxypyruvate | ||
+ | ** OH-pyruvate | ||
+ | ** OH-pyr | ||
+ | ** 3-hydroxypyruvate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN0-300]] |
− | + | * [[GLYCERATE-DEHYDROGENASE-RXN]] | |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN0-305]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 1113-60-6 |
− | {{#set: | + | * BIGG : hpyr |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4186339 4186339] |
− | {{#set: | + | * HMDB : HMDB01352 |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00168 C00168] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.3397158.html 3397158] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17180 17180] | ||
+ | * METABOLIGHTS : MTBLC17180 | ||
+ | {{#set: smiles=C(C(=O)C([O-])=O)O}} | ||
+ | {{#set: common name=hydroxypyruvate}} | ||
+ | {{#set: inchi key=InChIKey=HHDDCCUIIUWNGJ-UHFFFAOYSA-M}} | ||
+ | {{#set: molecular weight=103.054 }} | ||
+ | {{#set: common name=β-hydroxypyruvate|OH-pyruvate|OH-pyr|3-hydroxypyruvate}} | ||
+ | {{#set: consumed by=RXN0-300|GLYCERATE-DEHYDROGENASE-RXN}} | ||
+ | {{#set: reversible reaction associated=RXN0-305}} |
Latest revision as of 20:57, 21 March 2018
Contents
Metabolite OH-PYR
- smiles:
- C(C(=O)C([O-])=O)O
- common name:
- hydroxypyruvate
- inchi key:
- InChIKey=HHDDCCUIIUWNGJ-UHFFFAOYSA-M
- molecular weight:
- 103.054
- Synonym(s):
- β-hydroxypyruvate
- OH-pyruvate
- OH-pyr
- 3-hydroxypyruvate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 1113-60-6
- BIGG : hpyr
- PUBCHEM:
- HMDB : HMDB01352
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC17180
"C(C(=O)C([O-])=O)O" cannot be used as a page name in this wiki.