Difference between revisions of "RXN-12669"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1825 CPD-1825] == * smiles: ** C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O) * inchi key: ** InChIKey...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12669 RXN-12669] == * direction: ** LEFT-TO-RIGHT * common name: ** acyl-coenzyme_a_oxidase * e...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12669 RXN-12669] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** acyl-coenzyme_a_oxidase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.3.3.6 EC-1.3.3.6] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD-196]][c] '''=>''' 1 [[CPD0-2108]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c] |
− | == | + | * With common name(s): |
+ | ** 1 oxygen[c] '''+''' 1 octanoyl-CoA[c] '''=>''' 1 trans-oct-2-enoyl-CoA[c] '''+''' 1 hydrogen peroxide[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_18566]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-6920]], 6-gingerol analog biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6920 PWY-6920] | ||
+ | ** '''5''' reactions found over '''6''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=acyl-coenzyme_a_oxidase}} | |
− | + | {{#set: ec number=EC-1.3.3.6}} | |
− | + | {{#set: gene associated=Tiso_gene_18566}} | |
− | + | {{#set: in pathway=PWY-6920}} | |
− | + | {{#set: reconstruction category=orthology|annotation}} | |
− | + | {{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}} | |
− | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:57, 21 March 2018
Contents
Reaction RXN-12669
- direction:
- LEFT-TO-RIGHT
- common name:
- acyl-coenzyme_a_oxidase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 OXYGEN-MOLECULE[c] + 1 CPD-196[c] => 1 CPD0-2108[c] + 1 HYDROGEN-PEROXIDE[c]
- With common name(s):
- 1 oxygen[c] + 1 octanoyl-CoA[c] => 1 trans-oct-2-enoyl-CoA[c] + 1 hydrogen peroxide[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_18566
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
Pathways
- PWY-6920, 6-gingerol analog biosynthesis (engineered): PWY-6920
- 5 reactions found over 6 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation