Difference between revisions of "SEROTONIN"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_18337 == * left end position: ** 918 * transcription direction: ** NEGATIVE * right end position: ** 2858 * centisome position: ** 29.80519...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SEROTONIN SEROTONIN] == * smiles: ** C1(=C(CC[N+])C2(C=C(O)C=CC(N1)=2)) * common name: ** serot...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SEROTONIN SEROTONIN] == |
− | * | + | * smiles: |
− | ** | + | ** C1(=C(CC[N+])C2(C=C(O)C=CC(N1)=2)) |
− | * | + | * common name: |
− | ** | + | ** serotonin |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=QZAYGJVTTNCVMB-UHFFFAOYSA-O |
− | * | + | * molecular weight: |
− | ** | + | ** 177.225 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 5-HT | ||
+ | ** hydroxytryptamine | ||
+ | ** 5-hydroxytryptamine | ||
+ | ** 3-(2-aminoethyl)-1H-indol-5-ol | ||
+ | ** enteramine | ||
+ | ** thrombocytin | ||
+ | ** thrombotonin | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-10777]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 50-67-9 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4048638 4048638] |
− | {{#set: | + | * HMDB : HMDB00259 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00780 C00780] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.3264617.html 3264617] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=350546 350546] | ||
+ | * METABOLIGHTS : MTBLC350546 | ||
+ | {{#set: smiles=C1(=C(CC[N+])C2(C=C(O)C=CC(N1)=2))}} | ||
+ | {{#set: common name=serotonin}} | ||
+ | {{#set: inchi key=InChIKey=QZAYGJVTTNCVMB-UHFFFAOYSA-O}} | ||
+ | {{#set: molecular weight=177.225 }} | ||
+ | {{#set: common name=5-HT|hydroxytryptamine|5-hydroxytryptamine|3-(2-aminoethyl)-1H-indol-5-ol|enteramine|thrombocytin|thrombotonin}} | ||
+ | {{#set: consumed by=RXN-10777}} |
Latest revision as of 20:57, 21 March 2018
Contents
Metabolite SEROTONIN
- smiles:
- C1(=C(CC[N+])C2(C=C(O)C=CC(N1)=2))
- common name:
- serotonin
- inchi key:
- InChIKey=QZAYGJVTTNCVMB-UHFFFAOYSA-O
- molecular weight:
- 177.225
- Synonym(s):
- 5-HT
- hydroxytryptamine
- 5-hydroxytryptamine
- 3-(2-aminoethyl)-1H-indol-5-ol
- enteramine
- thrombocytin
- thrombotonin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 50-67-9
- PUBCHEM:
- HMDB : HMDB00259
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC350546
"C1(=C(CC[N+])C2(C=C(O)C=CC(N1)=2))" cannot be used as a page name in this wiki.