Difference between revisions of "CPD-709"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_20412 == * left end position: ** 2 * transcription direction: ** POSITIVE * right end position: ** 325 * centisome position: ** 0.14430015...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-709 CPD-709] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2C...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-709 CPD-709] == |
| − | * | + | * smiles: |
| − | ** 2 | + | ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34)))) |
| − | * | + | * common name: |
| − | ** | + | ** (5α)-campestan-3-one |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=DDJMOMHMVFXEQF-JBQSTXLYSA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 400.687 |
* Synonym(s): | * Synonym(s): | ||
| + | ** methylcholestanone | ||
| + | ** (24R)-24-methyl-5α-cholestan-3-one | ||
| + | ** 3-dehydro-campestanol | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-4230]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-711]] | |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16061343 16061343] |
| − | {{#set: | + | * HMDB : HMDB12116 |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18533 18533] |
| − | {{#set: | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C15786 C15786] | ||
| + | {{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}} | ||
| + | {{#set: common name=(5α)-campestan-3-one}} | ||
| + | {{#set: inchi key=InChIKey=DDJMOMHMVFXEQF-JBQSTXLYSA-N}} | ||
| + | {{#set: molecular weight=400.687 }} | ||
| + | {{#set: common name=methylcholestanone|(24R)-24-methyl-5α-cholestan-3-one|3-dehydro-campestanol}} | ||
| + | {{#set: consumed by=RXN-4230}} | ||
| + | {{#set: produced by=RXN-711}} | ||
Latest revision as of 19:58, 21 March 2018
Contents
Metabolite CPD-709
- smiles:
- CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
- common name:
- (5α)-campestan-3-one
- inchi key:
- InChIKey=DDJMOMHMVFXEQF-JBQSTXLYSA-N
- molecular weight:
- 400.687
- Synonym(s):
- methylcholestanone
- (24R)-24-methyl-5α-cholestan-3-one
- 3-dehydro-campestanol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
