Difference between revisions of "HBCO"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-709 CPD-709] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HBCO HBCO] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-Hydroxybutanoyl-CoA:NAD+ oxidoreduc...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-709 CPD-709] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=HBCO HBCO] ==
* smiles:
+
* direction:
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=DDJMOMHMVFXEQF-JBQSTXLYSA-N
+
 
* common name:
 
* common name:
** (5α)-campestan-3-one
+
** 3-Hydroxybutanoyl-CoA:NAD+ oxidoreductase
* molecular weight:
+
** 400.687   
+
 
* Synonym(s):
 
* Synonym(s):
** methylcholestanone
 
** (24R)-24-methyl-5α-cholestan-3-one
 
** 3-dehydro-campestanol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-4230]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[NAD]][c] '''+''' 1.0 [[S-3-HYDROXYBUTANOYL-COA]][c] '''=>''' 1.0 [[ACETOACETYL-COA]][c] '''+''' 1.0 [[NADH]][c] '''+''' 1.0 [[PROTON]][c]
* [[RXN-711]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1.0 NAD+[c] '''+''' 1.0 (S)-3-hydroxybutanoyl-CoA[c] '''=>''' 1.0 acetoacetyl-CoA[c] '''+''' 1.0 NADH[c] '''+''' 1.0 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_5857]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16061343 16061343]
+
{{#set: common name=3-Hydroxybutanoyl-CoA:NAD+ oxidoreductase}}
* CHEBI:
+
{{#set: gene associated=Tiso_gene_5857}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18533 18533]
+
{{#set: in pathway=}}
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
** [http://www.genome.jp/dbget-bin/www_bget?C15786 C15786]
+
{{#set: reconstruction source=orthology-creinhardtii}}
* HMDB : HMDB12116
+
{{#set: reconstruction tool=pantograph}}
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=DDJMOMHMVFXEQF-JBQSTXLYSA-N}}
+
{{#set: common name=(5α)-campestan-3-one}}
+
{{#set: molecular weight=400.687    }}
+
{{#set: common name=methylcholestanone|(24R)-24-methyl-5α-cholestan-3-one|3-dehydro-campestanol}}
+
{{#set: consumed by=RXN-4230}}
+
{{#set: produced by=RXN-711}}
+

Latest revision as of 19:58, 21 March 2018

Reaction HBCO

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-Hydroxybutanoyl-CoA:NAD+ oxidoreductase
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links