Difference between revisions of "RXN-14229"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE GUANOSINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) * inchi k...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14229 RXN-14229] == * direction: ** REVERSIBLE * common name: ** acyl-coenzyme_a_oxidase ** acy...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE GUANOSINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14229 RXN-14229] ==
−
* smiles:
+
* direction:
−
** C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=NYHBQMYGNKIUIF-UUOKFMHZSA-N
+
 
* common name:
 
* common name:
−
** guanosine
+
** acyl-coenzyme_a_oxidase
−
* molecular weight:
+
** acyl-_dehydrogenase
−
** 283.243   
+
** ORF
 +
** acyl-CoA_dehydrogenase
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.3.8.7 EC-1.3.8.7]
 
* Synonym(s):
 
* Synonym(s):
−
** nucleoside Q
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN0-366]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[PROTON]][c] '''+''' 1 [[ETF-Oxidized]][c] '''+''' 1 [[CPD-196]][c] '''<=>''' 1 [[ETF-Reduced]][c] '''+''' 1 [[CPD0-2108]][c]
−
* [[RXN-7609]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 H+[c] '''+''' 1 an oxidized electron-transfer flavoprotein[c] '''+''' 1 octanoyl-CoA[c] '''<=>''' 1 a reduced electron-transfer flavoprotein[c] '''+''' 1 trans-oct-2-enoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_17967]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_883]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_6475]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_18566]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_8272]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_5991]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_14511]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_16631]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 118-00-3
+
* RHEA:
−
* METABOLIGHTS : MTBLC16750
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30944 30944]
−
* DRUGBANK : DB02857
+
* LIGAND-RXN:
−
* PUBCHEM:
+
** [http://www.genome.jp/dbget-bin/www_bget?R03777 R03777]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6802 6802]
+
{{#set: direction=REVERSIBLE}}
−
* HMDB : HMDB00133
+
{{#set: common name=acyl-coenzyme_a_oxidase}}
−
* LIGAND-CPD:
+
{{#set: common name=acyl-_dehydrogenase}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00387 C00387]
+
{{#set: common name=ORF}}
−
* CHEMSPIDER:
+
{{#set: common name=acyl-CoA_dehydrogenase}}
−
** [http://www.chemspider.com/Chemical-Structure.6544.html 6544]
+
{{#set: ec number=EC-1.3.8.7}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_17967|Tiso_gene_883|Tiso_gene_6475|Tiso_gene_18566|Tiso_gene_8272|Tiso_gene_5991|Tiso_gene_14511|Tiso_gene_16631}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16750 16750]
+
{{#set: in pathway=}}
−
* BIGG : gsn
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: smiles=C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}}
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation|orthology-esiliculosus}}
−
{{#set: inchi key=InChIKey=NYHBQMYGNKIUIF-UUOKFMHZSA-N}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: common name=guanosine}}
+
−
{{#set: molecular weight=283.243    }}
+
−
{{#set: common name=nucleoside Q}}
+
−
{{#set: consumed by=RXN0-366}}
+
−
{{#set: produced by=RXN-7609}}
+

Latest revision as of 19:58, 21 March 2018

Reaction RXN-14229

  • direction:
    • REVERSIBLE
  • common name:
    • acyl-coenzyme_a_oxidase
    • acyl-_dehydrogenase
    • ORF
    • acyl-CoA_dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H+[c] + 1 an oxidized electron-transfer flavoprotein[c] + 1 octanoyl-CoA[c] <=> 1 a reduced electron-transfer flavoprotein[c] + 1 trans-oct-2-enoyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links






Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-14229&oldid=44986"