Difference between revisions of "GLYNA1tm"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2742 CPD-2742] == * smiles: ** C1(=O)(CC[CH](N(C)1)C2(C=NC=CC=2)) * inchi key: ** InChIKey=...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYNA1tm GLYNA1tm] == * direction: ** REVERSIBLE * common name: ** Neutral amino acid transporter (...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYNA1tm GLYNA1tm] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** Neutral amino acid transporter (gly), mitochondrial |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | * [[ | + | ** 1.0 [[NA+]][c] '''+''' 1.0 [[GLY]][c] '''<=>''' 1.0 [[NA+]][m] '''+''' 1.0 [[GLY]][m] |
| − | * [[ | + | * With common name(s): |
| − | * [[ | + | ** 1.0 Na+[c] '''+''' 1.0 glycine[c] '''<=>''' 1.0 Na+[m] '''+''' 1.0 glycine[m] |
| − | == | + | |
| − | == | + | == Genes associated with this reaction == |
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_1764]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: common name=Neutral amino acid transporter (gly), mitochondrial}} | |
| − | + | {{#set: gene associated=Tiso_gene_1764}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction source=orthology-creinhardtii}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:58, 21 March 2018
Contents
Reaction GLYNA1tm
- direction:
- REVERSIBLE
- common name:
- Neutral amino acid transporter (gly), mitochondrial
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1.0 Na+[c] + 1.0 glycine[c] <=> 1.0 Na+[m] + 1.0 glycine[m]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_1764
- Source: orthology-creinhardtii
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii
