Difference between revisions of "Tiso gene 2365"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-236 CPD-236] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C...")
(Created page with "Category:Gene == Gene Tiso_gene_2365 == * right end position: ** 10419 * transcription direction: ** NEGATIVE * left end position: ** 6551 * centisome position: ** 33.2116...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-236 CPD-236] ==
+
== Gene Tiso_gene_2365 ==
−
* smiles:
+
* right end position:
−
** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))
+
** 10419
−
* inchi key:
+
* transcription direction:
−
** InChIKey=BKBYHSYZKIAJDA-LPEMZMRWSA-M
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** gibberellin A29
+
** 6551
−
* molecular weight:
+
* centisome position:
−
** 347.387    
+
** 33.211662    
 
* Synonym(s):
 
* Synonym(s):
−
** GA29
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[3PGAREARR-RXN]]
−
* [[RXN-113]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[RXN-15509]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15510]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15511]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15512]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15513]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-1042]]
 +
* [[P341-PWY]]
 +
* [[PWY-2221]]
 +
* [[PWY-1622]]
 +
* [[GLUCONEO-PWY]]
 +
* [[GLYCOLYSIS]]
 +
* [[PWY-6901]]
 +
* [[ANAGLYCOLYSIS-PWY]]
 +
* [[PWY-7218]]
 +
* [[PWY-6405]]
 +
* [[P124-PWY]]
 +
* [[PWY-6886]]
 +
* [[PWY66-399]]
 +
* [[PWY-5723]]
 +
* [[PWY-6142]]
 +
* [[PWY-5484]]
 +
* [[PWY-7124]]
 +
* [[P122-PWY]]
 +
* [[PWY-7003]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=10419}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200412 25200412]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: left end position=6551}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28040 28040]
+
{{#set: centisome position=33.211662   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=3PGAREARR-RXN|RXN-15509|RXN-15510|RXN-15511|RXN-15512|RXN-15513}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06096 C06096]
+
{{#set: pathway associated=PWY-1042|P341-PWY|PWY-2221|PWY-1622|GLUCONEO-PWY|GLYCOLYSIS|PWY-6901|ANAGLYCOLYSIS-PWY|PWY-7218|PWY-6405|P124-PWY|PWY-6886|PWY66-399|PWY-5723|PWY-6142|PWY-5484|PWY-7124|P122-PWY|PWY-7003}}
−
{{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
+
−
{{#set: inchi key=InChIKey=BKBYHSYZKIAJDA-LPEMZMRWSA-M}}
+
−
{{#set: common name=gibberellin A29}}
+
−
{{#set: molecular weight=347.387   }}
+
−
{{#set: common name=GA29}}
+
−
{{#set: produced by=RXN-113}}
+

Latest revision as of 20:59, 21 March 2018

Gene Tiso_gene_2365

  • right end position:
    • 10419
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 6551
  • centisome position:
    • 33.211662
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_2365&oldid=45060"