Difference between revisions of "RXN-7903"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-718 CPD-718] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(=O)CCC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7903 RXN-7903] == * direction: ** LEFT-TO-RIGHT * common name: ** chloroplast_acyl-acp_desatura...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-718 CPD-718] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7903 RXN-7903] ==
* smiles:
+
* direction:
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=SVBMASFUJDIDJC-XFJIFGBKSA-N
+
 
* common name:
 
* common name:
** 3-dehydroteasterone
+
** chloroplast_acyl-acp_desaturase
* molecular weight:
+
* ec number:
** 446.669   
+
** [http://enzyme.expasy.org/EC/1.14.19.2 EC-1.14.19.2]
 
* Synonym(s):
 
* Synonym(s):
** dehydroteasterone
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-717]]
+
** 2 [[Reduced-ferredoxins]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[Stearoyl-ACPs]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 2 [[WATER]][c] '''+''' 1 [[Oleoyl-ACPs]][c] '''+''' 2 [[Oxidized-ferredoxins]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 2 a reduced ferredoxin [iron-sulfur] cluster[c] '''+''' 2 H+[c] '''+''' 1 a stearoyl-[acp][c] '''+''' 1 oxygen[c] '''=>''' 2 H2O[c] '''+''' 1 an oleoyl-[acp][c] '''+''' 2 an oxidized ferredoxin [iron-sulfur] cluster[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_6179]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-5147]], oleate biosynthesis I (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5147 PWY-5147]
 +
** '''3''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[manual]]
 +
** Source: [[manual-primary_network]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14353979 14353979]
+
{{#set: common name=chloroplast_acyl-acp_desaturase}}
* CHEBI:
+
{{#set: ec number=EC-1.14.19.2}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20000 20000]
+
{{#set: gene associated=Tiso_gene_6179}}
* LIGAND-CPD:
+
{{#set: in pathway=PWY-5147}}
** [http://www.genome.jp/dbget-bin/www_bget?C15792 C15792]
+
{{#set: reconstruction category=manual|annotation}}
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: reconstruction source=manual-primary_network|annotation-in-silico_annotation}}
{{#set: inchi key=InChIKey=SVBMASFUJDIDJC-XFJIFGBKSA-N}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: common name=3-dehydroteasterone}}
+
{{#set: molecular weight=446.669    }}
+
{{#set: common name=dehydroteasterone}}
+
{{#set: produced by=RXN-717}}
+

Latest revision as of 19:59, 21 March 2018

Reaction RXN-7903

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • chloroplast_acyl-acp_desaturase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5147, oleate biosynthesis I (plants): PWY-5147
    • 3 reactions found over 3 reactions in the full pathway

Reconstruction information

External links