Difference between revisions of "CPD0-1162"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_5392 == * Synonym(s): == Reactions associated == * FADSYN-RXN ** pantograph-creinhardtii == Pathways associated == * PWY66-3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1162 CPD0-1162] == * smiles: ** CCCCCCCCC=CCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1162 CPD0-1162] == |
+ | * smiles: | ||
+ | ** CCCCCCCCC=CCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O | ||
+ | * common name: | ||
+ | ** (2E,5Z)-tetradecenoyl-CoA | ||
+ | * inchi key: | ||
+ | ** InChIKey=JVEFYXPCQBMMAA-ZMLWRGBOSA-J | ||
+ | * molecular weight: | ||
+ | ** 969.83 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 2-trans,5-cis-tetradecenoyl-CoA | ||
+ | ** 14:2-Δ2,Δ5-CoA | ||
+ | ** 2-trans,5-cis-tetradecadienoyl-CoA | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-14576]] | |
− | == | + | * [[RXN-17783]] |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | * [[ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244134 25244134] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87701 87701] | ||
+ | {{#set: smiles=CCCCCCCCC=CCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}} | ||
+ | {{#set: common name=(2E,5Z)-tetradecenoyl-CoA}} | ||
+ | {{#set: inchi key=InChIKey=JVEFYXPCQBMMAA-ZMLWRGBOSA-J}} | ||
+ | {{#set: molecular weight=969.83 }} | ||
+ | {{#set: common name=2-trans,5-cis-tetradecenoyl-CoA|14:2-Δ2,Δ5-CoA|2-trans,5-cis-tetradecadienoyl-CoA}} | ||
+ | {{#set: produced by=RXN-14576|RXN-17783}} |
Latest revision as of 20:59, 21 March 2018
Contents
Metabolite CPD0-1162
- smiles:
- CCCCCCCCC=CCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
- common name:
- (2E,5Z)-tetradecenoyl-CoA
- inchi key:
- InChIKey=JVEFYXPCQBMMAA-ZMLWRGBOSA-J
- molecular weight:
- 969.83
- Synonym(s):
- 2-trans,5-cis-tetradecenoyl-CoA
- 14:2-Δ2,Δ5-CoA
- 2-trans,5-cis-tetradecadienoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCC=CCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.