Difference between revisions of "Tiso gene 9227"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-B CHLOROPHYLL-B] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC...")
(Created page with "Category:Gene == Gene Tiso_gene_9227 == * Synonym(s): == Reactions associated == * Reaction: 1.14.11.2-RXN ** Source: orthology-esiliculosus * Reaction: RXN490-...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-B CHLOROPHYLL-B] ==
+
== Gene Tiso_gene_9227 ==
* smiles:
+
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C(C=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)C(C(OC)=O)C5=C(N67)8)))))9))))
+
* common name:
+
** chlorophyll b
+
* molecular weight:
+
** 907.486   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[1.14.11.2-RXN]]
* [[RXN-7674]]
+
** Source: [[orthology-esiliculosus]]
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN490-3641]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=1.14.11.2-RXN|RXN490-3641}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11593175 11593175]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27888 27888]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C05307 C05307]
+
* HMDB : HMDB31146
+
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C(C=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)C(C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: common name=chlorophyll b}}
+
{{#set: molecular weight=907.486    }}
+
{{#set: produced by=RXN-7674}}
+

Latest revision as of 20:59, 21 March 2018

Gene Tiso_gene_9227

  • Synonym(s):

Reactions associated

Pathways associated

External links