Difference between revisions of "CPD-19153"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RIBAZOLEPHOSPHAT-RXN RIBAZOLEPHOSPHAT-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** plast...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19153 CPD-19153] == * smiles: ** CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RIBAZOLEPHOSPHAT-RXN RIBAZOLEPHOSPHAT-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19153 CPD-19153] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 
* common name:
 
* common name:
** plastid_phosphoglycerate_mutase_protein
+
** 3-oxo-(5Z)-dodecenoyl-CoA
* ec number:
+
* inchi key:
** [http://enzyme.expasy.org/EC/3.1.3.73 EC-3.1.3.73]
+
** InChIKey=VKLHSLOWDWGVGP-CGGPSVLLSA-J
 +
* molecular weight:
 +
** 957.775   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-oxo-12:1-Δ5-CoA
 +
** 3-oxo-5-cis-dodecenoyl-CoA
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-17799]]
** 1 [[ALPHA-RIBAZOLE-5-P]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[ALPHA-RIBAZOLE]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXN-17798]]
** 1 α-ribazole 5'-phosphate[c] '''+''' 1 H2O[c] '''=>''' 1 phosphate[c] '''+''' 1 α-ribazole[c]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Tiso_gene_16271]]
+
** IN-SILICO_ANNOTATION
+
***EC-NUMBER
+
== Pathways  ==
+
* [[PWY-5508]], adenosylcobalamin biosynthesis from cobyrinate a,c-diamide II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5508 PWY-5508]
+
** '''3''' reactions found over '''9''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
* RHEA:
+
{{#set: smiles=CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24456 24456]
+
{{#set: common name=3-oxo-(5Z)-dodecenoyl-CoA}}
* LIGAND-RXN:
+
{{#set: inchi key=InChIKey=VKLHSLOWDWGVGP-CGGPSVLLSA-J}}
** [http://www.genome.jp/dbget-bin/www_bget?R04594 R04594]
+
{{#set: molecular weight=957.775    }}
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: common name=3-oxo-12:1-Δ5-CoA|3-oxo-5-cis-dodecenoyl-CoA}}
{{#set: common name=plastid_phosphoglycerate_mutase_protein}}
+
{{#set: consumed by=RXN-17799}}
{{#set: ec number=EC-3.1.3.73}}
+
{{#set: produced by=RXN-17798}}
{{#set: gene associated=Tiso_gene_16271}}
+
{{#set: in pathway=PWY-5508}}
+
{{#set: reconstruction category=annotation}}
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
+
{{#set: reconstruction tool=pathwaytools}}
+

Latest revision as of 20:59, 21 March 2018

Metabolite CPD-19153

  • smiles:
    • CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • common name:
    • 3-oxo-(5Z)-dodecenoyl-CoA
  • inchi key:
    • InChIKey=VKLHSLOWDWGVGP-CGGPSVLLSA-J
  • molecular weight:
    • 957.775
  • Synonym(s):
    • 3-oxo-12:1-Δ5-CoA
    • 3-oxo-5-cis-dodecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.