Difference between revisions of "CPD-17372"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.23-RXN 2.3.1.23-RXN] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17372 CPD-17372] == * smiles: ** C(O)CCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O * common...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.23-RXN 2.3.1.23-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17372 CPD-17372] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C(O)CCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/2.3.1.23 EC-2.3.1.23]
+
** 1-[18-hydroxyoleyl]-2-lyso-phosphatidate
 +
* inchi key:
 +
** InChIKey=GFJKJLHWWZXDAU-KXFGNQBASA-L
 +
* molecular weight:
 +
** 450.508   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-16118]]
−
** 1 [[ACYL-COA]][c] '''+''' 1 [[2-Lysophosphatidylcholines]][c] '''<=>''' 1 [[CO-A]][c] '''+''' 1 [[PHOSPHATIDYLCHOLINE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 an acyl-CoA[c] '''+''' 1 a 1-acyl-sn-glycero-3-phosphocholine[c] '''<=>''' 1 coenzyme A[c] '''+''' 1 a phosphatidylcholine[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_10604]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-6803]], phosphatidylcholine acyl editing: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6803 PWY-6803]
+
−
** '''3''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PWY-7470]], phosphatidylcholine biosynthesis VII: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7470 PWY-7470]
+
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=12937 12937]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820233 91820233]
−
* LIGAND-RXN:
+
{{#set: smiles=C(O)CCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R01318 R01318]
+
{{#set: common name=1-[18-hydroxyoleyl]-2-lyso-phosphatidate}}
−
{{#set: direction=REVERSIBLE}}
+
{{#set: inchi key=InChIKey=GFJKJLHWWZXDAU-KXFGNQBASA-L}}
−
{{#set: ec number=EC-2.3.1.23}}
+
{{#set: molecular weight=450.508    }}
−
{{#set: gene associated=Tiso_gene_10604}}
+
{{#set: consumed by=RXN-16118}}
−
{{#set: in pathway=PWY-6803|PWY-7470}}
+
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction source=orthology-esiliculosus}}
+
−
{{#set: reconstruction tool=pantograph}}
+

Latest revision as of 20:00, 21 March 2018

Metabolite CPD-17372

  • smiles:
    • C(O)CCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O
  • common name:
    • 1-[18-hydroxyoleyl]-2-lyso-phosphatidate
  • inchi key:
    • InChIKey=GFJKJLHWWZXDAU-KXFGNQBASA-L
  • molecular weight:
    • 450.508
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)CCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O" cannot be used as a page name in this wiki.
"1-[18-hydroxyoleyl]-2-lyso-phosphatidate" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-17372&oldid=45147"