Difference between revisions of "CPD-2743"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_9068 == * left end position: ** 105 * transcription direction: ** POSITIVE * right end position: ** 6140 * centisome position: ** 1.0901163...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2743 CPD-2743] == * smiles: ** C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2)) * common name: ** nicotin...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_9068 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2743 CPD-2743] ==
* left end position:
+
* smiles:
** 105
+
** C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2))
* transcription direction:
+
* common name:
** POSITIVE
+
** nicotine-1'-N-oxide
* right end position:
+
* inchi key:
** 6140
+
** InChIKey=RWFBQHICRCUQJJ-NUHJPDEHSA-N
* centisome position:
+
* molecular weight:
** 1.0901163    
+
** 178.233    
 
* Synonym(s):
 
* Synonym(s):
 +
** nicotine N'-oxide
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[3.2.2.23-RXN]]
+
== Reaction(s) known to produce the compound ==
** in-silico_annotation
+
* [[RXN66-81]]
***ec-number
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=105}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=68107 68107]
{{#set: right end position=6140}}
+
* CHEMSPIDER:
{{#set: centisome position=1.0901163   }}
+
** [http://www.chemspider.com/Chemical-Structure.61415.html 61415]
{{#set: reaction associated=3.2.2.23-RXN}}
+
* HMDB : HMDB01497
 +
{{#set: smiles=C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2))}}
 +
{{#set: common name=nicotine-1'-N-oxide}}
 +
{{#set: inchi key=InChIKey=RWFBQHICRCUQJJ-NUHJPDEHSA-N}}
 +
{{#set: molecular weight=178.233   }}
 +
{{#set: common name=nicotine N'-oxide}}
 +
{{#set: produced by=RXN66-81}}

Latest revision as of 20:00, 21 March 2018

Metabolite CPD-2743

  • smiles:
    • C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2))
  • common name:
    • nicotine-1'-N-oxide
  • inchi key:
    • InChIKey=RWFBQHICRCUQJJ-NUHJPDEHSA-N
  • molecular weight:
    • 178.233
  • Synonym(s):
    • nicotine N'-oxide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • PUBCHEM:
  • CHEMSPIDER:
  • HMDB : HMDB01497
"C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2))" cannot be used as a page name in this wiki.