Difference between revisions of "P3I"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_14547 == * left end position: ** 300 * transcription direction: ** POSITIVE * right end position: ** 5080 * centisome position: ** 5.383097...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P3I P3I] == * smiles: ** [O-]P(OP(=O)(OP([O-])(=O)[O-])[O-])([O-])=O * common name: ** PPPi * i...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P3I P3I] == |
| − | * | + | * smiles: |
| − | ** | + | ** [O-]P(OP(=O)(OP([O-])(=O)[O-])[O-])([O-])=O |
| − | * | + | * common name: |
| − | ** | + | ** PPPi |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=UNXRWKVEANCORM-UHFFFAOYSA-I |
| − | * | + | * molecular weight: |
| − | ** | + | ** 252.915 |
* Synonym(s): | * Synonym(s): | ||
| + | ** inorganic triphosphate | ||
| + | ** tripolyphosphate | ||
| + | ** triphosphate | ||
| + | ** inorganic open chain tripolyphosphate | ||
| + | ** P3,i | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[BTUR2-RXN]] | |
| − | * [[ | + | * [[R344-RXN]] |
| − | + | * [[COBALADENOSYLTRANS-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 14127-68-5 |
| − | {{#set: | + | * BIGG : pppi |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3440921 3440921] |
| − | {{#set: | + | * HMDB : HMDB03379 |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00536 C00536] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.2683694.html 2683694] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18036 18036] | ||
| + | * METABOLIGHTS : MTBLC18036 | ||
| + | {{#set: smiles=[O-]P(OP(=O)(OP([O-])(=O)[O-])[O-])([O-])=O}} | ||
| + | {{#set: common name=PPPi}} | ||
| + | {{#set: inchi key=InChIKey=UNXRWKVEANCORM-UHFFFAOYSA-I}} | ||
| + | {{#set: molecular weight=252.915 }} | ||
| + | {{#set: common name=inorganic triphosphate|tripolyphosphate|triphosphate|inorganic open chain tripolyphosphate|P3,i}} | ||
| + | {{#set: produced by=BTUR2-RXN|R344-RXN|COBALADENOSYLTRANS-RXN}} | ||
Latest revision as of 20:00, 21 March 2018
Contents
Metabolite P3I
- smiles:
- [O-]P(OP(=O)(OP([O-])(=O)[O-])[O-])([O-])=O
- common name:
- PPPi
- inchi key:
- InChIKey=UNXRWKVEANCORM-UHFFFAOYSA-I
- molecular weight:
- 252.915
- Synonym(s):
- inorganic triphosphate
- tripolyphosphate
- triphosphate
- inorganic open chain tripolyphosphate
- P3,i
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 14127-68-5
- BIGG : pppi
- PUBCHEM:
- HMDB : HMDB03379
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC18036
"O-]P(OP(=O)(OP([O-])(=O)[O-])[O-])([O-])=O" cannot be used as a page name in this wiki.
