Difference between revisions of "Tiso gene 6671"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14602 CPD-14602] == * smiles: ** CC(CCC(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))=O)=CCC2(=C(C(C)=C3...")
(Created page with "Category:Gene == Gene Tiso_gene_6671 == * Synonym(s): == Reactions associated == * Reaction: RXN-13322 ** Source: orthology-esiliculosus * Reaction: RXN-9537...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14602 CPD-14602] ==
+
== Gene Tiso_gene_6671 ==
−
* smiles:
+
−
** CC(CCC(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(O)2)3))OC)
+
−
* inchi key:
+
−
** InChIKey=QBMSTEZXAMABFF-UEARNRKISA-M
+
−
* common name:
+
−
** mycophenolic acid O-acyl-glucuronide
+
−
* molecular weight:
+
−
** 495.459   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-13322]]
−
* [[RXN-13607]]
+
** Source: [[orthology-esiliculosus]]
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-9537]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[RXN-9543]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways associated ==
 +
* [[PWY-5972]]
 +
* [[PWY-5971]]
 +
* [[PWY-5994]]
 +
* [[PWY-6433]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: reaction associated=RXN-13322|RXN-9537|RXN-9543}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678773 70678773]
+
{{#set: pathway associated=PWY-5972|PWY-5971|PWY-5994|PWY-6433}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=66982 66982]
+
−
{{#set: smiles=CC(CCC(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(O)2)3))OC)}}
+
−
{{#set: inchi key=InChIKey=QBMSTEZXAMABFF-UEARNRKISA-M}}
+
−
{{#set: common name=mycophenolic acid O-acyl-glucuronide}}
+
−
{{#set: molecular weight=495.459    }}
+
−
{{#set: produced by=RXN-13607}}
+

Latest revision as of 20:00, 21 March 2018

Gene Tiso_gene_6671

  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_6671&oldid=45198"