Difference between revisions of "DGTP"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14249 RXN-14249] == * direction: ** LEFT-TO-RIGHT * common name: ** L-threonine 3-dehydrogenase...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGTP DGTP] == * smiles: ** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C=NC2(C(=...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGTP DGTP] == |
− | * | + | * smiles: |
− | ** | + | ** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) |
* common name: | * common name: | ||
− | ** | + | ** dGTP |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=HAAZLUGHYHWQIW-KVQBGUIXSA-J |
+ | * molecular weight: | ||
+ | ** 503.152 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 2'-deoxyguanosine-5'-triphosphate | ||
+ | ** deoxy-GTP | ||
+ | ** deoxyguanosine-triphosphate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[DGTCY]] |
− | + | * [[DGTUP]] | |
− | * | + | * [[RXN0-385]] |
− | + | * [[RME255]] | |
− | + | * [[RXN-11410]] | |
− | + | * [[RXN-14208]] | |
− | + | * [[RXN-14217]] | |
− | * [[ | + | * [[DGTD]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[ATDGD]] | |
− | == | + | * [[DGDPKIN-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | * [[RXN-14207]] |
− | * | + | |
− | * | + | |
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 2564-35-4 |
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246112 25246112] |
− | {{#set: | + | * HMDB : HMDB01440 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00286 C00286] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61429 61429] |
+ | * BIGG : dgtp | ||
+ | {{#set: smiles=C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}} | ||
+ | {{#set: common name=dGTP}} | ||
+ | {{#set: inchi key=InChIKey=HAAZLUGHYHWQIW-KVQBGUIXSA-J}} | ||
+ | {{#set: molecular weight=503.152 }} | ||
+ | {{#set: common name=2'-deoxyguanosine-5'-triphosphate|deoxy-GTP|deoxyguanosine-triphosphate}} | ||
+ | {{#set: consumed by=DGTCY|DGTUP|RXN0-385|RME255|RXN-11410|RXN-14208|RXN-14217|DGTD}} | ||
+ | {{#set: produced by=ATDGD|DGDPKIN-RXN}} | ||
+ | {{#set: reversible reaction associated=RXN-14207}} |
Latest revision as of 20:00, 21 March 2018
Contents
Metabolite DGTP
- smiles:
- C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
- common name:
- dGTP
- inchi key:
- InChIKey=HAAZLUGHYHWQIW-KVQBGUIXSA-J
- molecular weight:
- 503.152
- Synonym(s):
- 2'-deoxyguanosine-5'-triphosphate
- deoxy-GTP
- deoxyguanosine-triphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))" cannot be used as a page name in this wiki.