Difference between revisions of "CPD-15373"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15373 CPD-15373] == * smiles: ** [CH](=O)C(O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=GZCGUP...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15373 CPD-15373] == * smiles: ** [CH](=O)C(O)C(O)C(O)C(O)CO * common name: ** aldehydo-D-ma...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** [CH](=O)C(O)C(O)C(O)C(O)CO | ** [CH](=O)C(O)C(O)C(O)C(O)CO | ||
| − | |||
| − | |||
* common name: | * common name: | ||
** aldehydo-D-mannose | ** aldehydo-D-mannose | ||
| + | * inchi key: | ||
| + | ** InChIKey=GZCGUPFRVQAUEE-KVTDHHQDSA-N | ||
* molecular weight: | * molecular weight: | ||
** 180.157 | ** 180.157 | ||
| Line 23: | Line 23: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=37675 37675] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=37675 37675] | ||
{{#set: smiles=[CH](=O)C(O)C(O)C(O)C(O)CO}} | {{#set: smiles=[CH](=O)C(O)C(O)C(O)C(O)CO}} | ||
| − | |||
{{#set: common name=aldehydo-D-mannose}} | {{#set: common name=aldehydo-D-mannose}} | ||
| + | {{#set: inchi key=InChIKey=GZCGUPFRVQAUEE-KVTDHHQDSA-N}} | ||
{{#set: molecular weight=180.157 }} | {{#set: molecular weight=180.157 }} | ||
{{#set: consumed by=RXN-14501}} | {{#set: consumed by=RXN-14501}} | ||
{{#set: reversible reaction associated=1.1.1.255-RXN|RXN-14500}} | {{#set: reversible reaction associated=1.1.1.255-RXN|RXN-14500}} | ||
Latest revision as of 20:01, 21 March 2018
Contents
Metabolite CPD-15373
- smiles:
- [CH](=O)C(O)C(O)C(O)C(O)CO
- common name:
- aldehydo-D-mannose
- inchi key:
- InChIKey=GZCGUPFRVQAUEE-KVTDHHQDSA-N
- molecular weight:
- 180.157
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)C(O)C(O)C(O)C(O)CO" cannot be used as a page name in this wiki.
