Difference between revisions of "Tiso gene 5387"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1065 CPD0-1065] == * smiles: ** C(CC[N+]CCCCC[N+])[N+] * inchi key: ** InChIKey=QZBYOYPROV...")
 
(Created page with "Category:Gene == Gene Tiso_gene_5387 == * right end position: ** 11036 * transcription direction: ** POSITIVE * left end position: ** 8804 * centisome position: ** 64.9597...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1065 CPD0-1065] ==
+
== Gene Tiso_gene_5387 ==
−
* smiles:
+
* right end position:
−
** C(CC[N+]CCCCC[N+])[N+]
+
** 11036
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q
+
** POSITIVE
−
* common name:
+
* left end position:
−
** aminopropylcadaverine
+
** 8804
−
* molecular weight:
+
* centisome position:
−
** 162.298    
+
** 64.959785    
 
* Synonym(s):
 
* Synonym(s):
−
** N-3-aminopropyl-1,5-diaminopentane
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ADENYL-KIN-RXN]]
−
* [[RXN0-5217]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[DEOXYADENYLATE-KINASE-RXN]]
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways associated ==
 +
* [[PWY-7219]]
 +
* [[PWY-7224]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=11036}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246266 25246266]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=8804}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64858 64858]
+
{{#set: centisome position=64.959785   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=ADENYL-KIN-RXN|DEOXYADENYLATE-KINASE-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16565 C16565]
+
{{#set: pathway associated=PWY-7219|PWY-7224}}
−
* HMDB : HMDB12189
+
−
{{#set: smiles=C(CC[N+]CCCCC[N+])[N+]}}
+
−
{{#set: inchi key=InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q}}
+
−
{{#set: common name=aminopropylcadaverine}}
+
−
{{#set: molecular weight=162.298   }}
+
−
{{#set: common name=N-3-aminopropyl-1,5-diaminopentane}}
+
−
{{#set: produced by=RXN0-5217}}
+

Latest revision as of 19:06, 21 March 2018

Gene Tiso_gene_5387

  • right end position:
    • 11036
  • transcription direction:
    • POSITIVE
  • left end position:
    • 8804
  • centisome position:
    • 64.959785
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_5387&oldid=39522"