Difference between revisions of "R01220"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SECOLOGANIN-CPD SECOLOGANIN-CPD] == * smiles: ** C=C[CH]1(C(OC=C(C(=O)OC)[CH](CC=O)1)OC2(OC(CO)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R01220 R01220] == * direction: ** REVERSIBLE * common name: ** R146 * Synonym(s): == Reaction Form...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SECOLOGANIN-CPD SECOLOGANIN-CPD] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=R01220 R01220] ==
* smiles:
+
* direction:
** C=C[CH]1(C(OC=C(C(=O)OC)[CH](CC=O)1)OC2(OC(CO)C(O)C(O)C(O)2))
+
** REVERSIBLE
* inchi key:
+
** InChIKey=CSKKDSFETGLMSB-NRZPKYKESA-N
+
 
* common name:
 
* common name:
** secologanin
+
** R146
* molecular weight:
+
** 388.371   
+
 
* Synonym(s):
 
* Synonym(s):
** (-)-secologanin
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[STRICTOSIDINE-SYNTHASE-RXN]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[NADP]][c] '''+''' 1.0 [[METHYLENE-THF]][c] '''<=>''' 1.0 [[NADPH]][c] '''+''' 1.0 [[5-10-METHENYL-THF]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 NADP+[c] '''+''' 1.0 5,10-methylenetetrahydropteroyl mono-L-glutamate[c] '''<=>''' 1.0 NADPH[c] '''+''' 1.0 5,10-methenyltetrahydrofolate mono-L-glutamate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_432]]
 +
** Source: [[orthology-synechocystis]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-synechocystis]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMPR0102070002
+
{{#set: direction=REVERSIBLE}}
* PUBCHEM:
+
{{#set: common name=R146}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=161276 161276]
+
{{#set: gene associated=Tiso_gene_432}}
* CHEMSPIDER:
+
{{#set: in pathway=}}
** [http://www.chemspider.com/Chemical-Structure.141670.html 141670]
+
{{#set: reconstruction category=orthology}}
* CHEBI:
+
{{#set: reconstruction source=orthology-synechocystis}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18002 18002]
+
{{#set: reconstruction tool=pantograph}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C01852 C01852]
+
{{#set: smiles=C=C[CH]1(C(OC=C(C(=O)OC)[CH](CC=O)1)OC2(OC(CO)C(O)C(O)C(O)2))}}
+
{{#set: inchi key=InChIKey=CSKKDSFETGLMSB-NRZPKYKESA-N}}
+
{{#set: common name=secologanin}}
+
{{#set: molecular weight=388.371    }}
+
{{#set: common name=(-)-secologanin}}
+
{{#set: consumed by=STRICTOSIDINE-SYNTHASE-RXN}}
+

Latest revision as of 20:01, 21 March 2018

Reaction R01220

  • direction:
    • REVERSIBLE
  • common name:
    • R146
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 NADP+[c] + 1.0 5,10-methylenetetrahydropteroyl mono-L-glutamate[c] <=> 1.0 NADPH[c] + 1.0 5,10-methenyltetrahydrofolate mono-L-glutamate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links