Difference between revisions of "R95"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2231 CPD0-2231] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R95 R95] == * direction: ** LEFT-TO-RIGHT * common name: ** R95 * Synonym(s): == Reaction Formula...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2231 CPD0-2231] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=R95 R95] ==
−
* smiles:
+
* direction:
−
** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=BKUSIKGSPSFQAC-RRKCRQDMSA-K
+
 
* common name:
 
* common name:
−
** dIDP
+
** R95
−
* molecular weight:
+
−
** 409.165   
+
 
* Synonym(s):
 
* Synonym(s):
−
** deoxyinosine diphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1.0 [[OXYGEN-MOLECULE]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[CPD1F-98]][c] '''+''' 1.0 [[NADPH]][c] '''=>''' 1.0 [[NEUROSPORENE]][c] '''+''' 1.0 [[NADP]][c] '''+''' 2.0 [[WATER]][c]
−
* [[RXN-14228]]
+
* With common name(s):
 +
** 1.0 oxygen[c] '''+''' 1.0 H+[c] '''+''' 1.0 all-trans-ζ-carotene[c] '''+''' 1.0 NADPH[c] '''=>''' 1.0 all-trans neurosporene[c] '''+''' 1.0 NADP+[c] '''+''' 2.0 H2O[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_16794]]
 +
** Source: [[orthology-synechocystis]]
 +
* Gene: [[Tiso_gene_15802]]
 +
** Source: [[orthology-synechocystis]]
 +
* Gene: [[Tiso_gene_13369]]
 +
** Source: [[orthology-synechocystis]]
 +
* Gene: [[Tiso_gene_3092]]
 +
** Source: [[orthology-synechocystis]]
 +
* Gene: [[Tiso_gene_7142]]
 +
** Source: [[orthology-synechocystis]]
 +
* Gene: [[Tiso_gene_16795]]
 +
** Source: [[orthology-synechocystis]]
 +
* Gene: [[Tiso_gene_916]]
 +
** Source: [[orthology-synechocystis]]
 +
* Gene: [[Tiso_gene_917]]
 +
** Source: [[orthology-synechocystis]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-synechocystis]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01344 C01344]
+
{{#set: common name=R95}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_16794|Tiso_gene_15802|Tiso_gene_13369|Tiso_gene_3092|Tiso_gene_7142|Tiso_gene_16795|Tiso_gene_916|Tiso_gene_917}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62286 62286]
+
{{#set: in pathway=}}
−
* BIGG : didp
+
{{#set: reconstruction category=orthology}}
−
* PUBCHEM:
+
{{#set: reconstruction source=orthology-synechocystis}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173552 46173552]
+
{{#set: reconstruction tool=pantograph}}
−
* HMDB : HMDB03536
+
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))}}
+
−
{{#set: inchi key=InChIKey=BKUSIKGSPSFQAC-RRKCRQDMSA-K}}
+
−
{{#set: common name=dIDP}}
+
−
{{#set: molecular weight=409.165    }}
+
−
{{#set: common name=deoxyinosine diphosphate}}
+
−
{{#set: reversible reaction associated=RXN-14228}}
+

Latest revision as of 20:01, 21 March 2018

Reaction R95

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • R95
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 oxygen[c] + 1.0 H+[c] + 1.0 all-trans-ζ-carotene[c] + 1.0 NADPH[c] => 1.0 all-trans neurosporene[c] + 1.0 NADP+[c] + 2.0 H2O[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=R95&oldid=45308"