Difference between revisions of "RXN-16418"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5821 CPD-5821] == * smiles: ** C(C1(O)(NC(=O)N=C1NC(N)=O))(=O)[O-] * inchi key: ** InChIKey...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16418 RXN-16418] == * direction: ** LEFT-TO-RIGHT * common name: ** polyketide_synthase ** ORF...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5821 CPD-5821] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16418 RXN-16418] ==
−
* smiles:
+
* direction:
−
** C(C1(O)(NC(=O)N=C1NC(N)=O))(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=WHKYNCPIXMNTRQ-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** 2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline
+
** polyketide_synthase
−
* molecular weight:
+
** ORF
−
** 201.118   
+
** long_chain_acyl-_synthetase
 +
** acyl-_synthetase
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/6.2.1.3 EC-6.2.1.3]
 
* Synonym(s):
 
* Synonym(s):
−
** 5-hydroxy-2-oxo-4-ureido-2,5-dihydro-1H imidazole-5-carboxylate
 
−
** OHCU
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-6201]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[ATP]][c] '''+''' 1 [[OCTADEC-9-ENE-118-DIOIC-ACID]][c] '''+''' 1 [[CO-A]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[CPD-17624]][c] '''+''' 1 [[PPI]][c]
−
* [[3.5.2.17-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 ATP[c] '''+''' 1 α,ω-9Z-octadecenedioate[c] '''+''' 1 coenzyme A[c] '''=>''' 1 AMP[c] '''+''' 1 ω-carboxy-(9Z)-octadec-9-enoyl-CoA[c] '''+''' 1 diphosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_500]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_135]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_13394]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_10876]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_7855]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_9394]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_136]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_348]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_4191]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-1121]], suberin monomers biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-1121 PWY-1121]
 +
** '''9''' reactions found over '''19''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21145222 21145222]
+
{{#set: common name=polyketide_synthase}}
−
* CHEMSPIDER:
+
{{#set: common name=ORF}}
−
** [http://www.chemspider.com/Chemical-Structure.20016217.html 20016217]
+
{{#set: common name=long_chain_acyl-_synthetase}}
−
* CHEBI:
+
{{#set: common name=acyl-_synthetase}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58639 58639]
+
{{#set: ec number=EC-6.2.1.3}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Tiso_gene_500|Tiso_gene_135|Tiso_gene_13394|Tiso_gene_10876|Tiso_gene_7855|Tiso_gene_9394|Tiso_gene_136|Tiso_gene_348|Tiso_gene_4191}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C12248 C12248]
+
{{#set: in pathway=PWY-1121}}
−
* HMDB : HMDB59663
+
{{#set: reconstruction category=annotation}}
−
{{#set: smiles=C(C1(O)(NC(=O)N=C1NC(N)=O))(=O)[O-]}}
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
−
{{#set: inchi key=InChIKey=WHKYNCPIXMNTRQ-UHFFFAOYSA-M}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline}}
+
−
{{#set: molecular weight=201.118    }}
+
−
{{#set: common name=5-hydroxy-2-oxo-4-ureido-2,5-dihydro-1H imidazole-5-carboxylate|OHCU}}
+
−
{{#set: consumed by=RXN-6201}}
+
−
{{#set: produced by=3.5.2.17-RXN}}
+

Latest revision as of 20:02, 21 March 2018

Reaction RXN-16418

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • polyketide_synthase
    • ORF
    • long_chain_acyl-_synthetase
    • acyl-_synthetase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 ATP[c] + 1 α,ω-9Z-octadecenedioate[c] + 1 coenzyme A[c] => 1 AMP[c] + 1 ω-carboxy-(9Z)-octadec-9-enoyl-CoA[c] + 1 diphosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-1121, suberin monomers biosynthesis: PWY-1121
    • 9 reactions found over 19 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-16418&oldid=45361"