Difference between revisions of "Tiso gene 4164"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-315 CPD-315] == * smiles: ** CC4(=C(C)C=C3(N2(C%12(OC(CO)C(OP(=O)(O[CH](C)CNC(=O)CCC1(C)(C(...")
(Created page with "Category:Gene == Gene Tiso_gene_4164 == * right end position: ** 7436 * transcription direction: ** NEGATIVE * left end position: ** 6 * centisome position: ** 3.927215600...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-315 CPD-315] ==
+
== Gene Tiso_gene_4164 ==
−
* smiles:
+
* right end position:
−
** CC4(=C(C)C=C3(N2(C%12(OC(CO)C(OP(=O)(O[CH](C)CNC(=O)CCC1(C)(C(CC(=O)N)[CH]%11(C8(C)(C(CC(=O)N)(C)C(CCC(=O)N)C7(C(C)=C%10(C(CC(=O)N)(C)C(CCC(=O)N)C9(C=C6(C(C)(C)C(CCC(=O)N)C5(C(C)=C1N([Co---]([N+](=C2)C3=C4)(C#N)([N+]=56)([N+]=78)[N+]=9%10)%11)))))))))[O-])C(O)%12))))
+
** 7436
−
* inchi key:
+
* transcription direction:
−
** InChIKey=RMRCNWBMXRMIRW-WZHZPDAFSA-L
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** cyanocob(III)alamin
+
** 6
−
* molecular weight:
+
* centisome position:
−
** 1355.377   
+
** 3.927215600e-2
 
* Synonym(s):
 
* Synonym(s):
−
** cyanocobalamin
 
−
** rubramin
 
−
** vitamin B12
 
−
** alphamine
 
−
** crystamine
 
−
** cyanoject
 
−
** cyomin
 
−
** cytamen
 
−
** hydrobexan
 
−
** rubesol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[TransportSeed_CPD-315]]
+
* Reaction: [[3.1.3.16-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[TransportSeed_CPD-315]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[PROTEIN-TYROSINE-PHOSPHATASE-RXN]]
−
* [[ExchangeSeed_CPD-315]]
+
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* CAS : 68-19-9
+
{{#set: right end position=7436}}
−
* DRUGBANK : DB00115
+
{{#set: transcription direction=NEGATIVE}}
−
* PUBCHEM:
+
{{#set: left end position=6}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678590 70678590]
+
{{#set: centisome position=3.927215600e-2}}
−
* HMDB : HMDB00607
+
{{#set: reaction associated=3.1.3.16-RXN|PROTEIN-TYROSINE-PHOSPHATASE-RXN}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C02823 C02823]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17439 17439]
+
−
{{#set: smiles=CC4(=C(C)C=C3(N2(C%12(OC(CO)C(OP(=O)(O[CH](C)CNC(=O)CCC1(C)(C(CC(=O)N)[CH]%11(C8(C)(C(CC(=O)N)(C)C(CCC(=O)N)C7(C(C)=C%10(C(CC(=O)N)(C)C(CCC(=O)N)C9(C=C6(C(C)(C)C(CCC(=O)N)C5(C(C)=C1N([Co---]([N+](=C2)C3=C4)(C#N)([N+]=56)([N+]=78)[N+]=9%10)%11)))))))))[O-])C(O)%12))))}}
+
−
{{#set: inchi key=InChIKey=RMRCNWBMXRMIRW-WZHZPDAFSA-L}}
+
−
{{#set: common name=cyanocob(III)alamin}}
+
−
{{#set: molecular weight=1355.377    }}
+
−
{{#set: common name=cyanocobalamin|rubramin|vitamin B12|alphamine|crystamine|cyanoject|cyomin|cytamen|hydrobexan|rubesol}}
+
−
{{#set: consumed by=TransportSeed_CPD-315}}
+
−
{{#set: produced by=TransportSeed_CPD-315}}
+
−
{{#set: reversible reaction associated=ExchangeSeed_CPD-315}}
+

Latest revision as of 20:02, 21 March 2018

Gene Tiso_gene_4164

  • right end position:
    • 7436
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 6
  • centisome position:
    • 3.927215600e-2
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_4164&oldid=45373"