Difference between revisions of "NICOTINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Lipoyl-Protein-L-Lysine Lipoyl-Protein-L-Lysine] == * common name: ** a [lipoyl-carrier protein...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINE NICOTINE] == * smiles: ** C1(CC[CH]([N+](C)1)C2(C=NC=CC=2)) * common name: ** (S)-nico...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Lipoyl-Protein-L-Lysine Lipoyl-Protein-L-Lysine] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINE NICOTINE] ==
 +
* smiles:
 +
** C1(CC[CH]([N+](C)1)C2(C=NC=CC=2))
 
* common name:
 
* common name:
** a [lipoyl-carrier protein]-L-lysine
+
** (S)-nicotine
 +
* inchi key:
 +
** InChIKey=SNICXCGAKADSCV-JTQLQIEISA-O
 +
* molecular weight:
 +
** 163.242   
 
* Synonym(s):
 
* Synonym(s):
 +
** nicotine
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-947]]
+
* [[RXN66-81]]
* [[RXN-17127]]
+
* [[RXN66-146]]
* [[RXN0-5098]]
+
* [[RXN66-83]]
* [[RXN-8655]]
+
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a [lipoyl-carrier protein]-L-lysine}}
+
* PUBCHEM:
{{#set: consumed by=RXN0-947|RXN-17127|RXN0-5098|RXN-8655}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6919000 6919000]
 +
* NCI:
 +
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=5065 5065]
 +
* HMDB : HMDB01934
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C00745 C00745]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.5294163.html 5294163]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59806 59806]
 +
{{#set: smiles=C1(CC[CH]([N+](C)1)C2(C=NC=CC=2))}}
 +
{{#set: common name=(S)-nicotine}}
 +
{{#set: inchi key=InChIKey=SNICXCGAKADSCV-JTQLQIEISA-O}}
 +
{{#set: molecular weight=163.242    }}
 +
{{#set: common name=nicotine}}
 +
{{#set: consumed by=RXN66-81|RXN66-146|RXN66-83}}

Latest revision as of 20:02, 21 March 2018

Metabolite NICOTINE

  • smiles:
    • C1(CC[CH]([N+](C)1)C2(C=NC=CC=2))
  • common name:
    • (S)-nicotine
  • inchi key:
    • InChIKey=SNICXCGAKADSCV-JTQLQIEISA-O
  • molecular weight:
    • 163.242
  • Synonym(s):
    • nicotine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(CC[CH]([N+](C)1)C2(C=NC=CC=2))" cannot be used as a page name in this wiki.