Difference between revisions of "Linoleoyl-groups"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13576 CPD-13576] == * smiles: ** CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1) * inchi key: *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Linoleoyl-groups Linoleoyl-groups] == * common name: ** a [glycerolipid]-linoleate * Synonym(s)...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Linoleoyl-groups Linoleoyl-groups] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a [glycerolipid]-linoleate |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** a [glycerolipid]-cis,cis-9,12-octadecadienoate |
| + | ** a [glycerolipid]-(9Z,12Z)-octadeca-9,12-dienoate | ||
| + | ** a [glycerolipid]-9,12-linoleic acid | ||
| + | ** a [glycerolipid]-9-cis,12-cis-octadecadienoate | ||
| + | ** a linoleoyl-[glycerolipid] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-11680]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a [glycerolipid]-linoleate}} | |
| − | + | {{#set: common name=a [glycerolipid]-cis,cis-9,12-octadecadienoate|a [glycerolipid]-(9Z,12Z)-octadeca-9,12-dienoate|a [glycerolipid]-9,12-linoleic acid|a [glycerolipid]-9-cis,12-cis-octadecadienoate|a linoleoyl-[glycerolipid]}} | |
| − | + | {{#set: consumed by=RXN-11680}} | |
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | + | ||
| − | {{#set: consumed by=RXN- | + | |
Latest revision as of 21:02, 21 March 2018
Contents
Metabolite Linoleoyl-groups
- common name:
- a [glycerolipid]-linoleate
- Synonym(s):
- a [glycerolipid]-cis,cis-9,12-octadecadienoate
- a [glycerolipid]-(9Z,12Z)-octadeca-9,12-dienoate
- a [glycerolipid]-9,12-linoleic acid
- a [glycerolipid]-9-cis,12-cis-octadecadienoate
- a linoleoyl-[glycerolipid]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a [glycerolipid]-linoleate" cannot be used as a page name in this wiki.
- "a [glycerolipid]-cis,cis-9,12-octadecadienoate" cannot be used as a page name in this wiki.
- "a [glycerolipid]-(9Z,12Z)-octadeca-9,12-dienoate" cannot be used as a page name in this wiki.
- "a [glycerolipid]-9,12-linoleic acid" cannot be used as a page name in this wiki.
- "a [glycerolipid]-9-cis,12-cis-octadecadienoate" cannot be used as a page name in this wiki.
- "a linoleoyl-[glycerolipid" cannot be used as a page name in this wiki.
