Difference between revisions of "RXN-1121"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-RHAMNOSE DTDP-RHAMNOSE] == * smiles: ** CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1121 RXN-1121] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With id...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-RHAMNOSE DTDP-RHAMNOSE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1121 RXN-1121] ==
−
* smiles:
+
* direction:
−
** CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(C)C(O)C(O)C(O)2))O3))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=ZOSQFDVXNQFKBY-CGAXJHMRSA-L
+
−
* common name:
+
−
** dTDP-β-L-rhamnose
+
−
* molecular weight:
+
−
** 546.317   
+
 
* Synonym(s):
 
* Synonym(s):
−
** dTDP-6-deoxy-β-L-mannose
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[DTDPDEHYRHAMREDUCT-RXN]]
+
** 1 [[FERULIC-ACID]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[5-HYDROXY-FERULIC-ACID]][c] '''+''' 1 [[NADP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 ferulate[c] '''+''' 1 NADPH[c] '''+''' 1 H+[c] '''+''' 1 oxygen[c] '''=>''' 1 H2O[c] '''+''' 1 5-hydroxyferulate[c] '''+''' 1 NADP+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_17028]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_8263]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_3577]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_11183]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_1547]]
 +
** Source: [[orthology-athaliana]]
 +
== Pathways  ==
 +
* [[PWY-2181]], free phenylpropanoid acid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2181 PWY-2181]
 +
** '''3''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 572-96-3
+
* LIGAND-RXN:
−
* PUBCHEM:
+
** [http://www.genome.jp/dbget-bin/www_bget?R07440 R07440]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245982 25245982]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* HMDB : HMDB06354
+
{{#set: gene associated=Tiso_gene_17028|Tiso_gene_8263|Tiso_gene_3577|Tiso_gene_11183|Tiso_gene_1547}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-2181}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03319 C03319]
+
{{#set: reconstruction category=orthology}}
−
* CHEBI:
+
{{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57510 57510]
+
{{#set: reconstruction tool=pantograph}}
−
* BIGG : dtdprmn
+
−
{{#set: smiles=CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(C)C(O)C(O)C(O)2))O3))}}
+
−
{{#set: inchi key=InChIKey=ZOSQFDVXNQFKBY-CGAXJHMRSA-L}}
+
−
{{#set: common name=dTDP-β-L-rhamnose}}
+
−
{{#set: molecular weight=546.317    }}
+
−
{{#set: common name=dTDP-6-deoxy-β-L-mannose}}
+
−
{{#set: produced by=DTDPDEHYRHAMREDUCT-RXN}}
+

Latest revision as of 20:02, 21 March 2018

Reaction RXN-1121

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-2181, free phenylpropanoid acid biosynthesis: PWY-2181
    • 3 reactions found over 4 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-1121&oldid=45435"