Difference between revisions of "CPD-12513"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8022 RXN-8022] == * direction: ** LEFT-TO-RIGHT * Synonym(s): ** Crtlb ** phytoene desaturase (...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12513 CPD-12513] == * smiles: ** C3(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8022 RXN-8022] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12513 CPD-12513] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C3(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(O)C(O)C(O)3)
 +
* common name:
 +
** UDP-β-L-arabinopyranose
 +
* inchi key:
 +
** InChIKey=DQQDLYVHOTZLOR-IAZOVDBXSA-L
 +
* molecular weight:
 +
** 534.263   
 
* Synonym(s):
 
* Synonym(s):
−
** Crtlb
 
−
** phytoene desaturase (ambiguous)
 
−
** 2-step phytoene desaturase (ambiguous)
 
−
** two-step phytoene desaturase (ambiguous)
 
−
** CrtI (ambiguous)
 
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[Acceptor]][c] '''+''' 1 [[CPD1F-98]][c] '''=>''' 1 [[Donor-H2]][c] '''+''' 1 [[NEUROSPORENE]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[UDP-ARABINOSE-4-EPIMERASE-RXN]]
−
** 1 an oxidized electron acceptor[c] '''+''' 1 all-trans-ζ-carotene[c] '''=>''' 1 a reduced electron acceptor[c] '''+''' 1 all-trans neurosporene[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_7142]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-6287]], neurosporene biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6287 PWY-6287]
+
−
** '''4''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30614 30614]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246220 25246220]
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R04798 R04798]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61457 61457]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=C3(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(O)C(O)C(O)3)}}
−
{{#set: common name=Crtlb|phytoene desaturase (ambiguous)|2-step phytoene desaturase (ambiguous)|two-step phytoene desaturase (ambiguous)|CrtI (ambiguous)}}
+
{{#set: common name=UDP-β-L-arabinopyranose}}
−
{{#set: gene associated=Tiso_gene_7142}}
+
{{#set: inchi key=InChIKey=DQQDLYVHOTZLOR-IAZOVDBXSA-L}}
−
{{#set: in pathway=PWY-6287}}
+
{{#set: molecular weight=534.263    }}
−
{{#set: reconstruction category=orthology}}
+
{{#set: reversible reaction associated=UDP-ARABINOSE-4-EPIMERASE-RXN}}
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=esiliculosus}}
+

Latest revision as of 19:29, 21 March 2018

Metabolite CPD-12513

  • smiles:
    • C3(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(O)C(O)C(O)3)
  • common name:
    • UDP-β-L-arabinopyranose
  • inchi key:
    • InChIKey=DQQDLYVHOTZLOR-IAZOVDBXSA-L
  • molecular weight:
    • 534.263
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C3(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(O)C(O)C(O)3)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-12513&oldid=41905"