Difference between revisions of "RXN-14177"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-181 CPD0-181] == * smiles: ** C(OP([O-])([O-])=O)C2(C(O)C(O)C(N1(C=NC=C(NC(=O)[O-])1))O2)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14177 RXN-14177] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-181 CPD0-181] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14177 RXN-14177] ==
−
* smiles:
+
* direction:
−
** C(OP([O-])([O-])=O)C2(C(O)C(O)C(N1(C=NC=C(NC(=O)[O-])1))O2)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=JHLXDWGVSYMXPL-XVFCMESISA-K
+
** [http://enzyme.expasy.org/EC/2.1.1.163 EC-2.1.1.163]
−
* common name:
+
−
** N5-carboxyaminoimidazole ribonucleotide
+
−
* molecular weight:
+
−
** 336.174   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 5-carboxyamino-1-(5-phospho-D-ribosyl)imidazole
 
−
** 5-phosphoribosyl-5-carboxyaminoimidazole
 
−
** N5-CAIR
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN0-742]]
+
** 1 [[CPD-15152]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[CPD-15153]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone[c] '''+''' 1 S-adenosyl-L-methionine[c] '''=>''' 1 3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone[c] '''+''' 1 H+[c] '''+''' 1 S-adenosyl-L-homocysteine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_20504]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_9109]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_17244]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_13355]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_19352]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_12366]]
 +
** Source: [[orthology-athaliana]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
* RHEA:
−
** [http://www.genome.jp/dbget-bin/www_bget?C15667 C15667]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=26465 26465]
−
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58730 58730]
+
{{#set: ec number=EC-2.1.1.163}}
−
* BIGG : 5caiz
+
{{#set: gene associated=Tiso_gene_20504|Tiso_gene_9109|Tiso_gene_17244|Tiso_gene_13355|Tiso_gene_19352|Tiso_gene_12366}}
−
* PUBCHEM:
+
{{#set: in pathway=}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202011 25202011]
+
{{#set: reconstruction category=orthology}}
−
* HMDB : HMDB12268
+
{{#set: reconstruction source=orthology-athaliana}}
−
{{#set: smiles=C(OP([O-])([O-])=O)C2(C(O)C(O)C(N1(C=NC=C(NC(=O)[O-])1))O2)}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: inchi key=InChIKey=JHLXDWGVSYMXPL-XVFCMESISA-K}}
+
−
{{#set: common name=N5-carboxyaminoimidazole ribonucleotide}}
+
−
{{#set: molecular weight=336.174    }}
+
−
{{#set: common name=5-carboxyamino-1-(5-phospho-D-ribosyl)imidazole|5-phosphoribosyl-5-carboxyaminoimidazole|N5-CAIR}}
+
−
{{#set: produced by=RXN0-742}}
+

Latest revision as of 20:03, 21 March 2018

Reaction RXN-14177

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone[c] + 1 S-adenosyl-L-methionine[c] => 1 3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone[c] + 1 H+[c] + 1 S-adenosyl-L-homocysteine[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-14177&oldid=45523"