Difference between revisions of "RXN-14276"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-AMINO-3-3-OXOPROP-2-ENYL-BUT-2-ENEDI 2-AMINO-3-3-OXOPROP-2-ENYL-BUT-2-ENEDI] == * smiles: **...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14276 RXN-14276] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-AMINO-3-3-OXOPROP-2-ENYL-BUT-2-ENEDI 2-AMINO-3-3-OXOPROP-2-ENYL-BUT-2-ENEDI] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14276 RXN-14276] ==
−
* smiles:
+
* direction:
−
** C(=O)([O-])C(=C(C([O-])=O)N)C=C[CH]=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=KACPVQQHDVBVFC-PMRVSPHWSA-L
+
** [http://enzyme.expasy.org/EC/4.2.1.119 EC-4.2.1.119]
−
* common name:
+
−
** aminocarboxymuconate semialdehyde
+
−
* molecular weight:
+
−
** 183.12   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2-amino-3-carboxymuconate-6-semialdehyde
 
−
** 2-amino-3-carboxymuconate semialdehyde
 
−
** 2-amino-3-(3-oxoprop-1-en-1-yl)-but-2-enedioate
 
−
** (E,E)-2-amino-3-(3-oxoprop-1-enyl)but-2-enedioate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-5721]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD0-2108]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-14916]][c]
−
* [[1.13.11.6-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 trans-oct-2-enoyl-CoA[c] '''+''' 1 H2O[c] '''=>''' 1 (R)-3-hydroxyoctanoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_6885]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_14262]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_16145]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-6920]], 6-gingerol analog biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6920 PWY-6920]
 +
** '''5''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9543319 9543319]
+
{{#set: ec number=EC-4.2.1.119}}
−
* HMDB : HMDB01330
+
{{#set: gene associated=Tiso_gene_6885|Tiso_gene_14262|Tiso_gene_16145}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-6920}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04409 C04409]
+
{{#set: reconstruction category=orthology}}
−
* CHEMSPIDER:
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
** [http://www.chemspider.com/Chemical-Structure.7822292.html 7822292]
+
{{#set: reconstruction tool=pantograph}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=994 994]
+
−
* METABOLIGHTS : MTBLC994
+
−
{{#set: smiles=C(=O)([O-])C(=C(C([O-])=O)N)C=C[CH]=O}}
+
−
{{#set: inchi key=InChIKey=KACPVQQHDVBVFC-PMRVSPHWSA-L}}
+
−
{{#set: common name=aminocarboxymuconate semialdehyde}}
+
−
{{#set: molecular weight=183.12    }}
+
−
{{#set: common name=2-amino-3-carboxymuconate-6-semialdehyde|2-amino-3-carboxymuconate semialdehyde|2-amino-3-(3-oxoprop-1-en-1-yl)-but-2-enedioate|(E,E)-2-amino-3-(3-oxoprop-1-enyl)but-2-enedioate}}
+
−
{{#set: consumed by=RXN-5721}}
+
−
{{#set: produced by=1.13.11.6-RXN}}
+

Latest revision as of 20:03, 21 March 2018

Reaction RXN-14276

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 trans-oct-2-enoyl-CoA[c] + 1 H2O[c] => 1 (R)-3-hydroxyoctanoyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6920, 6-gingerol analog biosynthesis (engineered): PWY-6920
    • 5 reactions found over 6 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-14276&oldid=45551"