Difference between revisions of "CPD-334"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CD-SP-2Fe2S-Complex CD-SP-2Fe2S-Complex] == * common name: ** a [cysteine desulfurase]-[scaffol...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-334 CPD-334] == * smiles: ** C(C(C(C(C(C([O-])=O)=O)=O)O)O)O * common name: ** 2,3-dioxo-L-...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-334 CPD-334] == |
| + | * smiles: | ||
| + | ** C(C(C(C(C(C([O-])=O)=O)=O)O)O)O | ||
* common name: | * common name: | ||
| − | ** | + | ** 2,3-dioxo-L-gulonate |
| + | * inchi key: | ||
| + | ** InChIKey=GJQWCDSAOUMKSE-STHAYSLISA-M | ||
| + | * molecular weight: | ||
| + | ** 191.117 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** (4R,5S)-4,5,6-trihydroxy-2,3-dioxohexanoate | ||
| + | ** 2,3-diketo-L-gulonate | ||
| + | ** DKG | ||
| + | ** L-xylo-hex-2-enonic acid | ||
| + | ** L-xylo-hex-2-enonate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-12870]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-12861]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * BIGG : 23doguln |
| − | {{#set: consumed by=RXN- | + | * PUBCHEM: |
| − | {{#set: produced by=RXN- | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21145097 21145097] |
| + | * HMDB : HMDB05971 | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.20015966.html 20015966] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57441 57441] | ||
| + | * METABOLIGHTS : MTBLC57441 | ||
| + | {{#set: smiles=C(C(C(C(C(C([O-])=O)=O)=O)O)O)O}} | ||
| + | {{#set: common name=2,3-dioxo-L-gulonate}} | ||
| + | {{#set: inchi key=InChIKey=GJQWCDSAOUMKSE-STHAYSLISA-M}} | ||
| + | {{#set: molecular weight=191.117 }} | ||
| + | {{#set: common name=(4R,5S)-4,5,6-trihydroxy-2,3-dioxohexanoate|2,3-diketo-L-gulonate|DKG|L-xylo-hex-2-enonic acid|L-xylo-hex-2-enonate}} | ||
| + | {{#set: consumed by=RXN-12870}} | ||
| + | {{#set: produced by=RXN-12861}} | ||
Latest revision as of 20:03, 21 March 2018
Contents
Metabolite CPD-334
- smiles:
- C(C(C(C(C(C([O-])=O)=O)=O)O)O)O
- common name:
- 2,3-dioxo-L-gulonate
- inchi key:
- InChIKey=GJQWCDSAOUMKSE-STHAYSLISA-M
- molecular weight:
- 191.117
- Synonym(s):
- (4R,5S)-4,5,6-trihydroxy-2,3-dioxohexanoate
- 2,3-diketo-L-gulonate
- DKG
- L-xylo-hex-2-enonic acid
- L-xylo-hex-2-enonate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : 23doguln
- PUBCHEM:
- HMDB : HMDB05971
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC57441
"C(C(C(C(C(C([O-])=O)=O)=O)O)O)O" cannot be used as a page name in this wiki.
