Difference between revisions of "CPD1F-126"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3R-9Z-3-hydroxy-octadec-9-enoyl-ACPs 3R-9Z-3-hydroxy-octadec-9-enoyl-ACPs] == * common name: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-126 CPD1F-126] == * smiles: ** CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(C)(C)CCCC=1...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-126 CPD1F-126] == |
| + | * smiles: | ||
| + | ** CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(C)(C)CCCC=1C))C)C)C)C)C)C | ||
* common name: | * common name: | ||
| − | ** | + | ** γ-carotene |
| + | * inchi key: | ||
| + | ** InChIKey=HRQKOYFGHJYEFS-BXOLYSJBSA-N | ||
| + | * molecular weight: | ||
| + | ** 536.882 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** β,ψ-carotene | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN1F-151]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN1F-150]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIPID_MAPS : LMPR01070260 |
| − | {{#set: consumed by= | + | * PUBCHEM: |
| − | {{#set: produced by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280791 5280791] |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.4444349.html 4444349] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27740 27740] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C05435 C05435] | ||
| + | {{#set: smiles=CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(C)(C)CCCC=1C))C)C)C)C)C)C}} | ||
| + | {{#set: common name=γ-carotene}} | ||
| + | {{#set: inchi key=InChIKey=HRQKOYFGHJYEFS-BXOLYSJBSA-N}} | ||
| + | {{#set: molecular weight=536.882 }} | ||
| + | {{#set: common name=β,ψ-carotene}} | ||
| + | {{#set: consumed by=RXN1F-151}} | ||
| + | {{#set: produced by=RXN1F-150}} | ||
Latest revision as of 20:03, 21 March 2018
Contents
Metabolite CPD1F-126
- smiles:
- CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(C)(C)CCCC=1C))C)C)C)C)C)C
- common name:
- γ-carotene
- inchi key:
- InChIKey=HRQKOYFGHJYEFS-BXOLYSJBSA-N
- molecular weight:
- 536.882
- Synonym(s):
- β,ψ-carotene
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
