Difference between revisions of "Tiso gene 2159"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ILE ILE] == * smiles: ** CCC(C)C([N+])C(=O)[O-] * inchi key: ** InChIKey=AGPKZVBTJJNPAG-WHFBIAK...")
(Created page with "Category:Gene == Gene Tiso_gene_2159 == * right end position: ** 15716 * transcription direction: ** POSITIVE * left end position: ** 13819 * centisome position: ** 67.707...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ILE ILE] ==
+
== Gene Tiso_gene_2159 ==
−
* smiles:
+
* right end position:
−
** CCC(C)C([N+])C(=O)[O-]
+
** 15716
−
* inchi key:
+
* transcription direction:
−
** InChIKey=AGPKZVBTJJNPAG-WHFBIAKZSA-N
+
** POSITIVE
−
* common name:
+
* left end position:
−
** L-isoleucine
+
** 13819
−
* molecular weight:
+
* centisome position:
−
** 131.174    
+
** 67.70701    
 
* Synonym(s):
 
* Synonym(s):
−
** I
 
−
** ile
 
−
** iso-leucine
 
−
** L-ile
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[ISOLEUCINE--TRNA-LIGASE-RXN]]
+
* Reaction: [[PYRIMSYN3-RXN]]
−
* [[RME144]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) known to produce the compound ==
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-12610]]
−
* [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]]
+
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12611]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[THI-P-SYN-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-6907]]
 +
* [[PWY-6890]]
 +
* [[PWY-7356]]
 +
* [[PWY-7357]]
 +
* [[PWY-6894]]
 +
* [[PWY-6897]]
 +
* [[PWY-7282]]
 +
* [[PWY-6908]]
 +
* [[PWY-6893]]
 +
* [[PWY-6910]]
 
== External links  ==
 
== External links  ==
−
* CAS : 73-32-5
+
{{#set: right end position=15716}}
−
* METABOLIGHTS : MTBLC58045
+
{{#set: transcription direction=POSITIVE}}
−
* PUBCHEM:
+
{{#set: left end position=13819}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7043901 7043901]
+
{{#set: centisome position=67.70701   }}
−
* HMDB : HMDB00172
+
{{#set: reaction associated=PYRIMSYN3-RXN|RXN-12610|RXN-12611|THI-P-SYN-RXN}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-6907|PWY-6890|PWY-7356|PWY-7357|PWY-6894|PWY-6897|PWY-7282|PWY-6908|PWY-6893|PWY-6910}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00407 C00407]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58045 58045]
+
−
* BIGG : ile__L
+
−
{{#set: smiles=CCC(C)C([N+])C(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=AGPKZVBTJJNPAG-WHFBIAKZSA-N}}
+
−
{{#set: common name=L-isoleucine}}
+
−
{{#set: molecular weight=131.174   }}
+
−
{{#set: common name=I|ile|iso-leucine|L-ile}}
+
−
{{#set: consumed by=ISOLEUCINE--TRNA-LIGASE-RXN|RME144}}
+
−
{{#set: reversible reaction associated=BRANCHED-CHAINAMINOTRANSFERILEU-RXN}}
+

Latest revision as of 20:04, 21 March 2018

Gene Tiso_gene_2159

  • right end position:
    • 15716
  • transcription direction:
    • POSITIVE
  • left end position:
    • 13819
  • centisome position:
    • 67.70701
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_2159&oldid=45647"