Difference between revisions of "P641-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHOSINE XANTHOSINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23))) * inchi...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P641-PWY P641-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
(4 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P641-PWY P641-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** phenylmercury acetate degradation |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''1''' reactions found over '''2''' reactions in the full pathway | |
− | * [[ | + | * [[MERCURY-II-REDUCTASE-RXN]] |
− | + | ** 1 associated gene(s): | |
− | * [[ | + | *** [[Tiso_gene_3724]] |
− | * [[ | + | ** 1 reconstruction source(s) associated: |
− | == Reaction(s) | + | *** [[annotation-in-silico_annotation]] |
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=R581-RXN R581-RXN] | ||
== External links == | == External links == | ||
− | * | + | * UM-BBD-PWY : ogm |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=phenylmercury acetate degradation}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=2}} | |
− | + | {{#set: completion rate=50.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:06, 21 March 2018
Pathway P641-PWY
- taxonomic range:
- common name:
- phenylmercury acetate degradation
- Synonym(s):
Reaction(s) found
1 reactions found over 2 reactions in the full pathway
- MERCURY-II-REDUCTASE-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- UM-BBD-PWY : ogm