Difference between revisions of "S-ubiquitinyl-E3-independent-E2-Cys"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-67 CPD-67] == * smiles: ** C(OP([O-])(=O)[O-])C([O-])=O * inchi key: ** InChIKey=ASCFNMCAHF...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ubiquitinyl-E3-independent-E2-Cys S-ubiquitinyl-E3-independent-E2-Cys] == * common name: ** a...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-67 CPD-67] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ubiquitinyl-E3-independent-E2-Cys S-ubiquitinyl-E3-independent-E2-Cys] ==
−
* smiles:
+
−
** C(OP([O-])(=O)[O-])C([O-])=O
+
−
* inchi key:
+
−
** InChIKey=ASCFNMCAHFUBCO-UHFFFAOYSA-K
+
 
* common name:
 
* common name:
−
** 2-phosphoglycolate
+
** an S-ubiquitinyl-[(E3-independent) E2 ubiquitin-conjugating enzyme]-L-cysteine
−
* molecular weight:
+
−
** 153.008   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2-P-glycolate
+
** an S-ubiquitinyl-[(E3-independent) ubiquitin-conjugating enzyme E2]-L-cysteine
−
** phosphoglycolate
+
−
** Phosphoglycolic acid
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[GPH-RXN]]
+
* [[RXN-16313]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-16314]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* BIGG : 2pglyc
+
{{#set: common name=an S-ubiquitinyl-[(E3-independent) E2 ubiquitin-conjugating enzyme]-L-cysteine}}
−
* PUBCHEM:
+
{{#set: common name=an S-ubiquitinyl-[(E3-independent) ubiquitin-conjugating enzyme E2]-L-cysteine}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24916760 24916760]
+
{{#set: consumed by=RXN-16313}}
−
* HMDB : HMDB00816
+
{{#set: produced by=RXN-16314}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00988 C00988]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58033 58033]
+
−
* METABOLIGHTS : MTBLC58033
+
−
{{#set: smiles=C(OP([O-])(=O)[O-])C([O-])=O}}
+
−
{{#set: inchi key=InChIKey=ASCFNMCAHFUBCO-UHFFFAOYSA-K}}
+
−
{{#set: common name=2-phosphoglycolate}}
+
−
{{#set: molecular weight=153.008    }}
+
−
{{#set: common name=2-P-glycolate|phosphoglycolate|Phosphoglycolic acid}}
+
−
{{#set: consumed by=GPH-RXN}}
+

Latest revision as of 20:04, 21 March 2018

Metabolite S-ubiquitinyl-E3-independent-E2-Cys

  • common name:
    • an S-ubiquitinyl-[(E3-independent) E2 ubiquitin-conjugating enzyme]-L-cysteine
  • Synonym(s):
    • an S-ubiquitinyl-[(E3-independent) ubiquitin-conjugating enzyme E2]-L-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an S-ubiquitinyl-[(E3-independent) E2 ubiquitin-conjugating enzyme]-L-cysteine" cannot be used as a page name in this wiki.
"an S-ubiquitinyl-[(E3-independent) ubiquitin-conjugating enzyme E2]-L-cysteine" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=S-ubiquitinyl-E3-independent-E2-Cys&oldid=45653"