Difference between revisions of "PWY0-1584"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LANOSTEROL LANOSTEROL] == * smiles: ** CC(C)=CCCC([CH]1(C2(C)(C(C)(CC1)C4(=C(CC2)C3([CH](C(C)(C...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1584 PWY0-1584] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LANOSTEROL LANOSTEROL] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1584 PWY0-1584] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C)=CCCC([CH]1(C2(C)(C(C)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
** InChIKey=CAHGCLMLTWQZNJ-BQNIITSRSA-N
+
 
* common name:
 
* common name:
−
** lanosterol
+
** nitrate reduction X (dissimilatory, periplasmic)
−
* molecular weight:
+
−
** 426.724   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 4,4,14α-trimethyl-5α-cholesta-8,24-dien-3β-ol
+
** periplasmic glycerol-3-phosphate to nitrate electron transfer
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN3O-130]]
+
'''1''' reactions found over '''2''' reactions in the full pathway
−
* [[RXN66-303]]
+
* [[RXN0-5260]]
−
== Reaction(s) known to produce the compound ==
+
** 1 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_15777]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6369 RXN0-6369]
 
== External links  ==
 
== External links  ==
−
* CAS : 79-63-0
+
* ECOCYC:
−
* DRUGBANK : DB03696
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-1584 PWY0-1584]
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2157}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=246983 246983]
+
{{#set: taxonomic range=TAX-2}}
−
* HMDB : HMDB01251
+
{{#set: common name=nitrate reduction X (dissimilatory, periplasmic)}}
−
* LIGAND-CPD:
+
{{#set: common name=periplasmic glycerol-3-phosphate to nitrate electron transfer}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01724 C01724]
+
{{#set: reaction found=1}}
−
* CHEBI:
+
{{#set: total reaction=2}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16521 16521]
+
{{#set: completion rate=50.0}}
−
* METABOLIGHTS : MTBLC16521
+
−
{{#set: smiles=CC(C)=CCCC([CH]1(C2(C)(C(C)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C}}
+
−
{{#set: inchi key=InChIKey=CAHGCLMLTWQZNJ-BQNIITSRSA-N}}
+
−
{{#set: common name=lanosterol}}
+
−
{{#set: molecular weight=426.724    }}
+
−
{{#set: common name=4,4,14α-trimethyl-5α-cholesta-8,24-dien-3β-ol}}
+
−
{{#set: consumed by=RXN3O-130|RXN66-303}}
+

Latest revision as of 19:29, 21 March 2018

Pathway PWY0-1584

  • taxonomic range:
  • common name:
    • nitrate reduction X (dissimilatory, periplasmic)
  • Synonym(s):
    • periplasmic glycerol-3-phosphate to nitrate electron transfer

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY0-1584&oldid=41924"