Difference between revisions of "CPD-293"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-Phosphoserines Protein-Phosphoserines] == * common name: ** a protein L-serine phosphat...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-293 CPD-293] == * smiles: ** CC(=O)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-293 CPD-293] == |
+ | * smiles: | ||
+ | ** CC(=O)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34)))) | ||
* common name: | * common name: | ||
− | ** | + | ** 5-α-pregnane-3,20-dione |
+ | * inchi key: | ||
+ | ** InChIKey=XMRPGKVKISIQBV-BJMCWZGWSA-N | ||
+ | * molecular weight: | ||
+ | ** 316.483 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 3,20-allopregnanedione |
+ | ** 3,20-dioxo-5-α-pregnane | ||
+ | ** 5-α-dihydroprogesterone | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[PROGESTERONE-5-ALPHA-REDUCTASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | {{#set: common name= | + | * CAS : 566-65-4 |
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=92810 92810] |
+ | * HMDB : HMDB03759 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C03681 C03681] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.83782.html 83782] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28952 28952] | ||
+ | * METABOLIGHTS : MTBLC28952 | ||
+ | {{#set: smiles=CC(=O)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}} | ||
+ | {{#set: common name=5-α-pregnane-3,20-dione}} | ||
+ | {{#set: inchi key=InChIKey=XMRPGKVKISIQBV-BJMCWZGWSA-N}} | ||
+ | {{#set: molecular weight=316.483 }} | ||
+ | {{#set: common name=3,20-allopregnanedione|3,20-dioxo-5-α-pregnane|5-α-dihydroprogesterone}} | ||
+ | {{#set: produced by=PROGESTERONE-5-ALPHA-REDUCTASE-RXN}} |
Latest revision as of 20:04, 21 March 2018
Contents
Metabolite CPD-293
- smiles:
- CC(=O)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
- common name:
- 5-α-pregnane-3,20-dione
- inchi key:
- InChIKey=XMRPGKVKISIQBV-BJMCWZGWSA-N
- molecular weight:
- 316.483
- Synonym(s):
- 3,20-allopregnanedione
- 3,20-dioxo-5-α-pregnane
- 5-α-dihydroprogesterone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 566-65-4
- PUBCHEM:
- HMDB : HMDB03759
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC28952
"CC(=O)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.