Difference between revisions of "PGCM"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-318 CPD-318] == * smiles: ** C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1) * inchi key: ** InChIKey=LHFJO...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PGCM PGCM] == * direction: ** REVERSIBLE * common name: ** phosphoglucomutase * Synonym(s): == Rea...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PGCM PGCM] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** phosphoglucomutase |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | + | ** 1.0 [[GLC-1-P]][c] '''<=>''' 1.0 [[ALPHA-GLC-6-P]][c] | |
| − | + | * With common name(s): | |
| − | * [[ | + | ** 1.0 α-D-glucopyranose 1-phosphate[c] '''<=>''' 1.0 α-D-glucose 6-phosphate[c] |
| − | * [[ | + | |
| − | == | + | == Genes associated with this reaction == |
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_13477]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | * Gene: [[Tiso_gene_4816]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: common name=phosphoglucomutase}} | |
| − | + | {{#set: gene associated=Tiso_gene_13477|Tiso_gene_4816}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction source=orthology-creinhardtii}} | |
| − | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 21:04, 21 March 2018
Contents
Reaction PGCM
- direction:
- REVERSIBLE
- common name:
- phosphoglucomutase
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 GLC-1-P[c] <=> 1.0 ALPHA-GLC-6-P[c]
- With common name(s):
- 1.0 α-D-glucopyranose 1-phosphate[c] <=> 1.0 α-D-glucose 6-phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_13477
- Source: orthology-creinhardtii
- Gene: Tiso_gene_4816
- Source: orthology-creinhardtii
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii
