Difference between revisions of "DNA-N"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1130 CPD-1130] == * smiles: ** CCC(C([O-])=O)C(C(=O)[O-])O * inchi key: ** InChIKey=JUCRENB...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DNA-N DNA-N] == * common name: ** DNAn * Synonym(s): ** DNA(N) == Reaction(s) known to consume...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DNA-N DNA-N] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** DNAn |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** DNA(N) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[DNA-DIRECTED-DNA-POLYMERASE-RXN]] |
+ | * [[RXN0-4961]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[DNA-DIRECTED-DNA-POLYMERASE-RXN]] | ||
+ | * [[DNA-LIGASE-ATP-RXN]] | ||
+ | * [[RXN-17919]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[RNA-DIRECTED-DNA-POLYMERASE-RXN]] |
== External links == | == External links == | ||
− | + | {{#set: common name=DNAn}} | |
− | + | {{#set: common name=DNA(N)}} | |
− | + | {{#set: consumed by=DNA-DIRECTED-DNA-POLYMERASE-RXN|RXN0-4961}} | |
− | + | {{#set: produced by=DNA-DIRECTED-DNA-POLYMERASE-RXN|DNA-LIGASE-ATP-RXN|RXN-17919}} | |
− | + | {{#set: reversible reaction associated=RNA-DIRECTED-DNA-POLYMERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: reversible reaction associated= | + |
Latest revision as of 20:04, 21 March 2018
Contents
Metabolite DNA-N
- common name:
- DNAn
- Synonym(s):
- DNA(N)