Difference between revisions of "CPD-1130"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRP-tRNAs TRP-tRNAs] == * common name: ** a tRNAtrp * Synonym(s): ** TRNA(TRP) == Reaction(s)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1130 CPD-1130] == * smiles: ** CCC(C([O-])=O)C(C(=O)[O-])O * common name: ** 3-ethylmalate...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1130 CPD-1130] == |
+ | * smiles: | ||
+ | ** CCC(C([O-])=O)C(C(=O)[O-])O | ||
* common name: | * common name: | ||
− | ** | + | ** 3-ethylmalate |
+ | * inchi key: | ||
+ | ** InChIKey=JUCRENBZZQKFGK-UHFFFAOYSA-L | ||
+ | * molecular weight: | ||
+ | ** 160.126 | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-14986]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-18210]] | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21145023 21145023] |
− | {{#set: consumed by= | + | * CHEMSPIDER: |
+ | ** [http://www.chemspider.com/Chemical-Structure.20015785.html 20015785] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57425 57425] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01989 C01989] | ||
+ | {{#set: smiles=CCC(C([O-])=O)C(C(=O)[O-])O}} | ||
+ | {{#set: common name=3-ethylmalate}} | ||
+ | {{#set: inchi key=InChIKey=JUCRENBZZQKFGK-UHFFFAOYSA-L}} | ||
+ | {{#set: molecular weight=160.126 }} | ||
+ | {{#set: consumed by=RXN-14986}} | ||
+ | {{#set: reversible reaction associated=RXN-18210}} |
Latest revision as of 20:04, 21 March 2018
Contents
Metabolite CPD-1130
- smiles:
- CCC(C([O-])=O)C(C(=O)[O-])O
- common name:
- 3-ethylmalate
- inchi key:
- InChIKey=JUCRENBZZQKFGK-UHFFFAOYSA-L
- molecular weight:
- 160.126
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC(C([O-])=O)C(C(=O)[O-])O" cannot be used as a page name in this wiki.